Loading Pathway...
82579 ChemSpider 1.0 937 ChemSpider 3a-Hydroxy-5b-pregnane-20-one 17alpha,21-Dihydroxypregnenolone HMDB0006759 HMDB CHOLESTEROL BioCyc 1.0 HMDB0006755 HMDB HMDB0006756 HMDB 439153 PubChem-compound HMDB0006757 HMDB HMDB0006758 HMDB ReactionCatalysis100858 ACTIVATION 1.0 ReactionCatalysis100857 ACTIVATION 83782 ChemSpider HMDB0006753 HMDB ReactionCatalysis100856 ACTIVATION HMDB0006754 HMDB ReactionCatalysis100855 ACTIVATION ReactionCatalysis100854 ACTIVATION ReactionCatalysis100853 ACTIVATION ReactionCatalysis100852 ACTIVATION ReactionCatalysis100851 ACTIVATION 53477897 PubChem-compound 53477896 PubChem-compound 1.0 53477898 PubChem-compound 1.0 389571 ChemSpider NADPH PW000050 PathWhiz HMDB0003259 HMDB 1.0 1.0 216208 ChemSpider HMDB0006762 HMDB 11b,17a,21-Trihydroxypreg-nenolone HMDB0006763 HMDB 600-57-7 CAS HMDB0006764 HMDB HMDB0006760 HMDB 1.0 6166 PubChem-compound 11b,21-Dihydroxy-5b-pregnane-3,20-dione CHEBI:16113 ChEBI 1164-98-3 CAS 24779614 PubChem-compound Transport1111 false Progesterone (→) Transport: Mus musculus, Cell, Endoplasmic Reticulum to Mus musculus, Cell, Cytoplasm LEFT_TO_RIGHT C05475 KEGG Compound 1.0 C01780 KEGG Compound PREGNENOLONE BioCyc 1.0 CHEBI:16474 ChEBI Hydrogen Ion CHEBI:15022 ChEBI Progesterone 952 ChemSpider ReactionCatalysis100872 ACTIVATION ReactionCatalysis100871 ACTIVATION ReactionCatalysis100870 ACTIVATION 1.14.15.6 false 1.14.15.6 20alpha-Hydroxycholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 20a,22b-Dihydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.14.15.6 false 1.14.15.6 Cholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 20alpha-Hydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1,25-dihydroxyvitamin D(3) 24-hydroxylase, mitochondrial Reaction110564 false NADP + Tetrahydrocortisone ↔ 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione + Hydrogen Ion + NADPH REVERSIBLE ReactionCatalysis100879 ACTIVATION 1.3.1.3 false 1.3.1.3 Dihydrocortisol + NADP ↔ Cortisol + Hydrogen Ion + NADPH REVERSIBLE ReactionCatalysis100878 ACTIVATION Reaction110562 false 20alpha-Hydroxycholesterol + Hydrogen Ion + NADPH + Oxygen → 17a,20a-Dihydroxycholesterol + NADP + Water LEFT_TO_RIGHT ReactionCatalysis100877 ACTIVATION 1.3.1.3 false 1.3.1.3 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione + NADP ↔ Cortisone + Hydrogen Ion + NADPH REVERSIBLE ReactionCatalysis100876 ACTIVATION 1.3.1.3 false 1.3.1.3 Hydrogen Ion + NADPH + Progesterone ↔ 5a-Pregnane-3,20-dione + NADP REVERSIBLE ReactionCatalysis100875 ACTIVATION Reaction110569 false 3a-Hydroxy-5b-pregnane-20-one + NADP ↔ 5a-Pregnane-3,20-dione + Hydrogen Ion + NADPH REVERSIBLE ReactionCatalysis100874 ACTIVATION Reaction110566 false NADP + Tetrahydrocortisol ↔ Dihydrocortisol + Hydrogen Ion + NADPH REVERSIBLE ReactionCatalysis100873 ACTIVATION 1.0 1.14.15.4 false 1.14.15.4 17alpha,21-Dihydroxypregnenolone + Oxygen + Reduced adrenal ferredoxin → 11b,17a,21-Trihydroxypreg-nenolone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 53477678 PubChem-compound 68-54-2 CAS ReactionCatalysis100859 ACTIVATION 1.0 2.0 167685 PubChem-compound 1010 ChemSpider CHEBI:16485 ChEBI P11714 UniProt ReactionCatalysis100861 ACTIVATION ReactionCatalysis100860 ACTIVATION 1.1.1.- false 1.1.1.- Cortisol + NADP → Cortisone + Hydrogen Ion + NADPH LEFT_TO_RIGHT Reaction110572 false Cortisol + Hydrogen Ion + NADH ↔ 11b,17a,21-Trihydroxypreg-nenolone + NAD REVERSIBLE 1.1.1.- false 1.1.1.- Corticosterone + NADP → 11-Dehydrocorticosterone + NADPH LEFT_TO_RIGHT ReactionCatalysis100869 ACTIVATION ReactionCatalysis100868 ACTIVATION ReactionCatalysis100867 ACTIVATION Mus musculus ReactionCatalysis100866 ACTIVATION 1.0 ReactionCatalysis100865 ACTIVATION ReactionCatalysis100864 ACTIVATION ReactionCatalysis100863 ACTIVATION ReactionCatalysis100862 ACTIVATION CHEBI:17026 ChEBI 1.14.99.10 false 1.14.99.10 Oxygen + Pregnenolone + Reduced acceptor → 21-Hydroxypregnenolone + Acceptor + Water LEFT_TO_RIGHT 1.14.15.4 false 1.14.15.4 17-Hydroxyprogesterone + Oxygen + Reduced adrenal ferredoxin → 21-Deoxycortisol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.0 1.0 1.0 20A-HYDROXY-CHOLESTEROL BioCyc Corticosteroid 11-beta-dehydrogenase isozyme 1 24774738 ChemSpider Tetrahydrocortisol 1.0 1.14.99.10 false 1.14.99.10 21-Deoxycortisol + Oxygen + Reduced acceptor → Acceptor + Cortisol + Water LEFT_TO_RIGHT 1.0 1.14.15.4 false 1.14.15.4 Deoxycorticosterone + Oxygen + Reduced adrenal ferredoxin → Corticosterone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.14.99.10 false 1.14.99.10 11b-Hydroxyprogesterone + Oxygen + Reduced acceptor → Acceptor + Corticosterone + Water LEFT_TO_RIGHT Reaction110541 false 21-Deoxycortisol + Acceptor + Water → 11b-Hydroxyprogesterone + Oxygen + Reduced acceptor LEFT_TO_RIGHT CHEBI:28043 ChEBI Reaction110546 false NAD + Pregnenolone → Hydrogen Ion + NADH + Progesterone LEFT_TO_RIGHT Reaction110547 false Oxygen + Progesterone + Reduced adrenal ferredoxin → 11b-Hydroxyprogesterone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT Reaction110544 false 21-Hydroxypregnenolone + NAD → Deoxycorticosterone + Hydrogen Ion + NADH LEFT_TO_RIGHT 1.14.99.10 false 1.14.99.10 Oxygen + Progesterone + Reduced acceptor → Acceptor + Deoxycorticosterone + Water LEFT_TO_RIGHT 21506239 ChemSpider 1.0 C00007 KEGG Compound Unknown 1.14.15.6 false 1.14.15.6 Cholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 22b-Hydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT C21H34O5 Tetrahydrocortisol 366.24063 C00006 KEGG Compound 566-65-4 CAS CHEBI:18009 ChEBI C00001 KEGG Compound NADP C21H32O2 5a-Pregnane-3,20-dione 316.24023 C00005 KEGG Compound 1.0 C00004 KEGG Compound C00003 KEGG Compound NADP HMDB0004029 HMDB 5a-Pregnane-3,20-dione 1.14.15.4 false 1.14.15.4 Cortexolone + Oxygen + Reduced adrenal ferredoxin → Cortisol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT Reaction110553 false Cortexolone + Hydrogen Ion + NADH ← 17alpha,21-Dihydroxypregnenolone + NAD RIGHT_TO_LEFT 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al Reaction110554 false Oxygen + Pregnenolone + Reduced acceptor → 17a-Hydroxypregnenolone + Acceptor + Water LEFT_TO_RIGHT Reaction110551 false Oxygen + Progesterone + Reduced acceptor → 17-Hydroxyprogesterone + Acceptor + Water LEFT_TO_RIGHT 22b-Hydroxycholesterol 1.14.99.10 false 1.14.99.10 17-Hydroxyprogesterone + Oxygen + Reduced acceptor → Acceptor + Cortexolone + Water LEFT_TO_RIGHT HMDB0004026 HMDB 1.14.15.6 false 1.14.15.6 17a,20a-Dihydroxycholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 17a-Hydroxypregnenolone + 4-Methylpentanal + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 17a-Hydroxypregnenolone 57-88-5 CAS 1.14.15.6 false 1.14.15.6 22b-Hydroxycholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 20a,22b-Dihydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.0 1.14.99.10 false 1.14.99.10 17a-Hydroxypregnenolone + Hydrogen Ion + NADPH + Oxygen ↔ 17alpha,21-Dihydroxypregnenolone + NADP + Water REVERSIBLE Corticosterone 1.14.15.6 false 1.14.15.6 20a,22b-Dihydroxycholesterol + 2 Hydrogen Ion + Oxygen + 2 Reduced adrenal ferredoxin → 4-Methylpentanal + 2 Oxidized adrenal ferredoxin + Pregnenolone + 2 Water LEFT_TO_RIGHT C21H32O5 3a,11b,21-Trihydroxy-20-oxo-5b-pregnan-18-al 364.22498 C21H32O5 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al 364.22498 C21H32O4 3a,21-Dihydroxy-5b-pregnane-11,20-dione 348.23007 15234-55-6 CAS C21H30O4 21-Hydroxy-5b-pregnane-3,11,20-trione 346.21442 C21H32O5 Tetrahydrocortisone 364.22498 1.0 C21H28N7O14P2 NAD 664.11694 Deoxycorticosterone HMDB0000903 HMDB HMDB0000902 HMDB ReactionCatalysis99989 ACTIVATION 11-Dehydrocorticosterone Oxygen 1.0 NAD(P) BioCyc 1.0 HMDB0004031 HMDB HMDB0004030 HMDB HMDB0004035 HMDB 1.0 Reaction110539 false 3a,21-Dihydroxy-5b-pregnane-11,20-dione + NADP → 21-Hydroxy-5b-pregnane-3,11,20-trione + Hydrogen Ion + NADPH LEFT_TO_RIGHT C27H46O3 17a,20a-Dihydroxycholesterol 418.3447 11222 PubChem-compound H Hydrogen Ion 1.007825 Reaction110537 false NADP + Tetrahydrocorticosterone ↔ 11b,21-Dihydroxy-5b-pregnane-3,20-dione + NADPH REVERSIBLE C21H28O5 Cortisone 360.19366 1.1.1.146 false 1.1.1.146 NADP + Tetrahydrocorticosterone → 3a,21-Dihydroxy-5b-pregnane-11,20-dione + Hydrogen Ion + NADPH LEFT_TO_RIGHT 72-23-1 CAS 5773 ChemSpider CHEBI:17252 ChEBI C21H32O4 11b,21-Dihydroxy-5b-pregnane-3,20-dione 348.23007 6238 PubChem-compound 5775 ChemSpider 53-84-9 CAS C21H30O5 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione 362.20932 C21H32O5 Dihydrocortisol 364.22498 C21H34O2 3a-Hydroxy-5b-pregnane-20-one 318.2559 C21H32O5 11b,17a,21-Trihydroxypreg-nenolone 364.22498 C21H32O4 17alpha,21-Dihydroxypregnenolone 348.23007 17a-Hydroxypregnenolone C27H46O3 20a,22b-Dihydroxycholesterol 418.3447 PW121886 PathWhiz Reaction110535 false 18-Hydroxycorticosterone + Oxygen + Reduced adrenal ferredoxin → Aldosterone + Oxidized adrenal ferredoxin + 2 Water LEFT_TO_RIGHT 1.14.15.4 false 1.14.15.4 Corticosterone + Oxygen + Reduced adrenal ferredoxin → 18-Hydroxycorticosterone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT Reaction110533 false 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al + NADPH → 3a,11b,21-Trihydroxy-20-oxo-5b-pregnan-18-al + NADP LEFT_TO_RIGHT 1.3.1.3 false 1.3.1.3 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al + NADP → Aldosterone + NADPH LEFT_TO_RIGHT 44263339 PubChem-compound 1.0 20alpha-Hydroxycholesterol C01124 KEGG Compound SMILES NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O HMDB0000015 HMDB SMILES [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C HMDB0000016 HMDB 1.0 13783449 PubChem-compound HMDB0000253 HMDB HMDB0000374 HMDB 1.0 17-Hydroxyprogesterone 1.0 C05499 KEGG Compound 1.0 HMDB0000268 HMDB C03681 KEGG Compound Progesterone 1.0 1.0 SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])C2CC[C@]2([H])C[C@H](O)CC[C@]12C Q9D665 UniProt Progesterone Pregnenolone C05502 KEGG Compound C03205 KEGG Compound 17a,20a-Dihydroxycholesterol 44725717 PubChem-compound 7732-18-5 CAS C27H46O2 20alpha-Hydroxycholesterol 402.3498 1.0 C05501 KEGG Compound C05500 KEGG Compound Water HMDB0001487 HMDB HMDB0000037 HMDB SMILES [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C 24850110 ChemSpider 1167-48-2 CAS Q05A13 UniProt 247020 PubChem-compound 4-METHYLPENTANAL BioCyc 44263345 PubChem-compound 1.0 44263347 PubChem-compound 68-96-2 CAS 1.0 1.0 C00187 KEGG Compound HMDB0001377 HMDB C02373 KEGG Compound SMILES CC(C)CCC=O 1.0 SMILES [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C 18-Hydroxycorticosterone 44263342 PubChem-compound 24850104 ChemSpider 24850108 ChemSpider 52-39-1 CAS 24850107 ChemSpider 962 PubChem-compound Reaction109716 false 17a-Hydroxypregnenolone + NAD → 17-Hydroxyprogesterone + Hydrogen Ion + NADH LEFT_TO_RIGHT Cortexolone 65554 PubChem-compound 1.0 Reduced adrenal ferredoxin Oxidized adrenal ferredoxin 92810 PubChem-compound 1.0 1.0 SMILES [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)C[C@@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C CPD-293 BioCyc C02140 KEGG Compound C00080 KEGG Compound ReactionCatalysis100893 ACTIVATION SMILES O=O 152-58-9 CAS 192735 PubChem-compound ReactionCatalysis100891 ACTIVATION 1119-16-0 CAS SMILES [H][C@@]12CC[C@H](C(O)=O)[C@@]1(C)C[C@@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C SMILES [H][C@@]12CC[C@H]([C@H](C)[C@H](O)CCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C HMDB0002111 HMDB 3a,21-Dihydroxy-5b-pregnane-11,20-dione Reduced adrenal ferredoxin Q9JII6 UniProt C01176 KEGG Compound 20a,22b-Dihydroxycholesterol NADP ReactionCatalysis100883 ACTIVATION Cytochrome P450 2C39 HMDB0000067 HMDB ReactionCatalysis100882 ACTIVATION ReactionCatalysis100881 ACTIVATION ReactionCatalysis100880 ACTIVATION SMILES [H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@]([H])(O)C[C@]12C)C(=O)CO ReactionCatalysis100889 ACTIVATION 68-42-8 CAS ReactionCatalysis100887 ACTIVATION HMDB0000063 HMDB ReactionCatalysis100886 ACTIVATION ReactionCatalysis100885 ACTIVATION ReactionCatalysis100884 ACTIVATION Oxidized adrenal ferredoxin Q64441 UniProt Unknown Dihydrocortisol 17alpha,21-Dihydroxypregnenolone CPD-272 BioCyc 21-Deoxycortisol 1.0 1.0 22833512 PubChem-compound 144508 ChemSpider H2O Water 18.010565 NADH BioCyc NAD BioCyc Cytochrome P450 2C54 977 PubChem-compound NADPH HMDB0059597 HMDB 50-23-7 CAS 5932 ChemSpider CPD-286 BioCyc 11b,17a,21-Trihydroxypreg-nenolone 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione 9863245 PubChem-compound 11b-Hydroxyprogesterone 21-Hydroxy-5b-pregnane-3,11,20-trione SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C 2.0 C21H30O5 18-Hydroxycorticosterone 362.20932 566-01-8 CAS Cytochrome P450 2D9 17215925 ChemSpider 440708 PubChem-compound 440707 PubChem-compound C21H28O5 Aldosterone 360.19366 129 PubChem-compound Corticosterone CHEBI:27832 ChEBI SMILES O 1.0 C21H30O3 17-Hydroxyprogesterone 330.21948 1.0 21-Hydroxypregnenolone 50-22-6 CAS Cortisol 6002 ChemSpider 126 ChemSpider SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(CO)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C 1,25-dihydroxyvitamin D(3) 24-hydroxylase, mitochondrial Q6XVG2 UniProt C27H46O Cholesterol 386.35486 CHEBI:15846 ChEBI C21H30O5 Cortisol 362.20932 2.0 17954-98-2 CAS C21H30O4 Cortexolone 346.21442 10090 TAXONOMY 53-59-8 CAS 1.0 1.0 C05469 KEGG Compound 5754 PubChem-compound C21H30O2 Progesterone 314.22458 1038 PubChem-compound 5997 PubChem-compound 5994 PubChem-compound 5753 PubChem-compound 1.0 C05473 KEGG Compound C05472 KEGG Compound C05474 KEGG Compound 2.0 C05471 KEGG Compound CHEBI:18093 ChEBI Hydrogen Ion C21H30O3 Deoxycorticosterone 330.21948 CHEBI:16906 ChEBI Tetrahydrocortisone SubPathwayInteraction57668 SubPathwayReaction SubPathway57668Reaction CHEBI:16908 ChEBI Tetrahydrocorticosterone 24758425 PubChem-compound 1.0 566-03-0 CAS SMP0120630 SMPDB HMDB0000319 HMDB C05477 KEGG Compound C05476 KEGG Compound 440711 PubChem-compound 53-02-1 CAS C05478 KEGG Compound C05485 KEGG Compound C05480 KEGG Compound Aldosterone C21H30N7O17P3 NADPH 745.0911 C21H29N7O17P3 NADP 744.08325 ALDOSTERONE BioCyc Mitochondrion C21H32O3 17a-Hydroxypregnenolone 332.23514 NADPH BioCyc 1.0 CHEBI:16973 ChEBI Acceptor SMILES [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C CPD-6641 BioCyc C05488 KEGG Compound C05487 KEGG Compound SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C C05489 KEGG Compound 58-68-4 CAS SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C Water 1.0 C05497 KEGG Compound Cortisone 1.0 C05490 KEGG Compound 1.0 HMDB0000217 HMDB HMDB0001547 HMDB NADH 21-Deoxycortisol 64-85-7 CAS Oxygen 1.0 C05498 KEGG Compound NADPH C05138 KEGG Compound SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O HMDB0000221 HMDB 1.0 SMILES [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C 1.0 1.0 CHEBI:1294 ChEBI CHEBI:28952 ChEBI SMILES C[C@]12CCC(=O)C=C1CCC1C3CC[C@H](C(=O)CO)[C@]3(C[C@H](O)C21)C=O CHEBI:1296 ChEBI SMILES NC(=O)C1=CN(C=CC1)[C@H]1O[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](OP(O)(O)=O)[C@H]2O)N2C=NC3=C(N)N=CN=C23)[C@H](O)[C@@H]1O C21H32O3 21-Hydroxypregnenolone 332.23514 91451 PubChem-compound 53-57-6 CAS 17-Hydroxyprogesterone 3a,11b,21-Trihydroxy-20-oxo-5b-pregnan-18-al 10748 ChemSpider C6H12O 4-Methylpentanal 100.08881 16735652 ChemSpider 11-DEOXY-CORTISOL BioCyc HMDB0001318 HMDB 222803 PubChem-compound 1.0 C21H29N7O14P2 NADH 665.12476 Cortisone Aldosterone CHEBI:16827 ChEBI C21H32O2 Pregnenolone 316.24023 1.0 17-alpha-Hydroxylase Deficiency (CYP17) CHEBI:16962 ChEBI Progesterone 24840621 ChemSpider 23141070 ChemSpider 2.0 Steroid Biosynthesis SubPathway CHEBI:385115 ChEBI GO:0005739 GENE ONTOLOGY GO:0005737 GENE ONTOLOGY HMDB0003759 HMDB Cortisol 1.0 1.0 1.0 HMDB0000363 HMDB C21H34O4 Tetrahydrocorticosterone 350.2457 SMILES CC12CC[C@@H](O)CC1CCC1C3CCC(C(=O)CO)C3(CC(O)C21)C=O SMILES [H][C@@]12CCC(C(=O)CO)C1(CC(O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C)C=O SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C Endoplasmic Reticulum Endoplasmic Reticulum Membrane 516-72-3 CAS SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=CN=C3N)[C@@H](O)[C@H]1O 5682 ChemSpider 11b-Hydroxyprogesterone 222786 PubChem-compound 1.0 561-65-9 CAS 11-Dehydrocorticosterone 11-DEOXYCORTICOSTERONE BioCyc 167253 ChemSpider SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C 58997 ChemSpider CHEBI:15339 ChEBI CHEBI:17998 ChEBI SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C SMILES CC12CC(O)C3C(CC=C4CC(O)CCC34C)C1CC[C@]2(O)C(=O)CO SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C Reduced acceptor SMILES [H][C@@]12CC[C@]([H])([C@@](C)(O)[C@H](O)CCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2CC(O)CC[C@]12C 5675 ChemSpider SMILES [H]C12CC[C@](O)([C@](C)(O)CCCC(C)C)[C@@]1(C)CCC1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C 1.0 5551 ChemSpider SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C 5550 ChemSpider SMILES [H][C@]12CCC3C4CC[C@H](C(C)=O)[C@@]4(C)CCC3[C@@]1(C)CC[C@@H](O)C2 1.0 4-Methylpentanal NAD Cytoplasm NADPH CHEBI:28750 ChEBI C00735 KEGG Compound 1.0 P56656 UniProt C21H28O4 11-Dehydrocorticosterone 344.19876 C21H30O4 21-Deoxycortisol 346.21442 Acceptor 388299 ChemSpider HMDB0000949 HMDB Reduced acceptor C27H46O2 22b-Hydroxycholesterol 402.3498 Hydrogen Ion 1.0 O2 Oxygen 31.98983 GO:0005789 GENE ONTOLOGY SMP0000023 SMPDB GO:0005783 GENE ONTOLOGY Deoxycorticosterone C20H28O4 11b-Hydroxyprogesterone 332.19876 C01953 KEGG Compound Cortisol 1.0 53-06-5 CAS Unknown 7782-44-7 CAS 1.0 Tetrahydrocorticosterone Cholesterol SubPathwayInput Alcohol dehydrogenase [NADP(+)] C21H30O4 Corticosterone 346.21442 1.0 Cytochrome P450 2C39 Cytochrome P450 2D9 Short-chain dehydrogenase/reductase family 16C member 6 1.0 Cytochrome P450 2C54 57-83-0 CAS Short-chain dehydrogenase/reductase family 42E member 1 SMILES CC(C)CCC[C@@](C)(O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C 5893 PubChem-compound CHEBI:28324 ChEBI 1.0 10417-86-4 CAS 1.0 1.0 Reaction1214 true Corticosterone → 11b,21-Dihydroxy-5b-pregnane-3,20-dione LEFT_TO_RIGHT 193458 ChemSpider CHEBI:15377 ChEBI 193441 ChemSpider CHEBI:15379 ChEBI HMDB0006283 HMDB CHEBI:15378 ChEBI SMILES [H+] 146693 ChemSpider 53-05-4 CAS 12444617 PubChem-compound 3a,21-Dihydroxy-5b-pregnane-11,20-dione 5886 PubChem-compound CHEBI:16581 ChEBI CHEBI:16341 ChEBI 1.0 C00762 KEGG Compound 1.0 440695 PubChem-compound HMDB0001830 HMDB 145-13-1 CAS Corticosterone HMDB0002802 HMDB CHEBI:783 ChEBI 387-79-1 CAS CHEBI:27584 ChEBI 1.0 Cortexolone 164838 PubChem-compound 389583 ChemSpider 389582 ChemSpider 389586 ChemSpider C00410 KEGG Compound 1.0 Corticosterone 641-77-0 CAS Reaction1234 true 11-Dehydrocorticosterone → 21-Hydroxy-5b-pregnane-3,11,20-trione LEFT_TO_RIGHT NADP Alcohol dehydrogenase [NADP(+)] Short-chain dehydrogenase/reductase family 42E member 1 1,25-dihydroxyvitamin D(3) 24-hydroxylase, mitochondrial 1482-50-4 CAS SMILES [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C Short-chain dehydrogenase/reductase family 16C member 6 CHEBI:17650 ChEBI SMILES C[C@]12C[C@H](O)C3C(CCC4C[C@H](O)CC[C@]34C)C1CC[C@]2(O)C(=O)CO Pregnenolone 1.0 8038941 ChemSpider