Quantitative metabolomics services for biomarker discovery and validation.
Specializing in ready to use metabolomics kits.
Your source for quantitative metabolomics technologies and bioinformatics.
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on PathBank.
Loading Pathway...
1.0 53481369 PubChem-compound HMDB06353 HMDB Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol HMDB12122 HMDB HMDB12121 HMDB Cytidine triphosphate HMDB12126 HMDB HMDB12125 HMDB 1.0 HMDB12124 HMDB HMDB12123 HMDB 6132 PubChem-compound CHEBI:17239 ChEBI UDP C21H39O9P Dolichyl b-D-glucosyl phosphate 466.23315 1.0 N-acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase CHEBI:58223 ChEBI CHEBI:16264 ChEBI HMDB12232 HMDB SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 528-04-1 CAS HMDB12119 HMDB HMDB12118 HMDB HMDB12117 HMDB 1.0 63-38-7 CAS HMDB01201 HMDB SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)OP(O)(=O)OC1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])N=C(C)[O-])=C(\C)CCC=C(C)C C9H14N2O12P2 UDP 404.0022 Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase CHEBI:15820 ChEBI Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Dolichyl b-D-glucosyl phosphate Dolichyl-phosphate beta-glucosyltransferase 1038 PubChem-compound Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase 1.0 SMILES CC(CCOP([O-])(=O)OP([O-])(=O)OC1OC(CO)C(OC2OC(CO)C(OC3OC(COC4OC(COC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C(O)C(OC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C4O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(OC5OC(CO)C(O)C(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)C5O)C4O)C3O)C(O)C2NC(C)=O)C(O)C1NC(C)=O)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C NN-DIACETYLCHITOBIOSYLDIPHOSPHODOLICHO BioCyc SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)O[C@]1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@]1([H])O)=C(\C)CCC=C(C)C Alpha-1,2-mannosyltransferase ALG9 P40351 UniProt C96H160N2O17P2 (N-Acetylglucosaminyl)2-diphosphodolichol 1675.1193 P40350 UniProt C150H250N2O62P2 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3133.5947 C144H240N2O57P2 (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol 2971.5417 HMDB59597 HMDB C114H190N2O32P2 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 2161.2776 C138H230N2O52P2 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol 2809.489 C132H220N2O47P2 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol 2647.4363 393240 ChemSpider C126H210N2O42P2 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol 2485.3833 Dolichol-phosphate mannosyltransferase Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase C04537 KEGG Compound C00105 KEGG Compound 6030 PubChem-compound UDP-N-acetylglucosamine transferase subunit ALG14 53481378 PubChem-compound 53477679 PubChem-compound Chitobiosyldiphosphodolichol beta-mannosyltransferase 2067-66-5 CAS Alpha-1,3/1,6-mannosyltransferase ALG2 GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase 133-89-1 CAS dolichol kinase UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase UDP-N-acetylglucosamine transferase Alg13p subunit 1010 ChemSpider C10H15N5O11P2 Guanosine diphosphate 443.02432 53481374 PubChem-compound 53481375 PubChem-compound P43636 UniProt P38179 UniProt 53481376 PubChem-compound 53481377 PubChem-compound 53481370 PubChem-compound 53481371 PubChem-compound 53481373 PubChem-compound 1.0 HMDB01546 HMDB Hydrogen Ion C88H145NO12P2 N-acetyl-α-D-glucosaminyl-diphosphodolichol 1470.0253 C168H278N2O77P2 (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3617.7385 C86H142O9P dolichyl β-D-mannosyl phosphate 1350.0397 C00112 KEGG Compound C15H24N2O17P2 Uridine diphosphate glucose 566.055 UDP-GLUCOSE BioCyc P20048 UniProt CDP 5280322 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 1.0 SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H](NC(C)=O)[C@@H](O)[C@@H]1O http://identifiers.org/smpdb/SMP02400 SMPDB SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 25245072 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O C17H27N3O17P2 Uridine diphosphate-N-acetylglucosamine 607.08154 1.0 C9H13N2O9P Uridine 5'-monophosphate 324.03586 P38242 UniProt GDP-MANNOSE BioCyc CTP BioCyc SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE BioCyc CDP BioCyc 2.4.1.141 false 2.4.1.141 N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine diphosphate-N-acetylglucosamine ? UDP + (N-Acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion 2.7.8.15 false 2.7.8.15 Dolichol phosphate + Uridine diphosphate-N-acetylglucosamine → N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine 5'-monophosphate LEFT_TO_RIGHT 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 Guanosine diphosphate mannose + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol → (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.142 false 2.4.1.142 (N-Acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → Guanosine diphosphate + Hydrogen Ion + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol LEFT_TO_RIGHT 2.4.1.131 false 2.4.1.131 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + 2 Guanosine diphosphate + 2 Hydrogen Ion LEFT_TO_RIGHT 1.0 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT P53868 UniProt 25245534 PubChem-compound SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1 Uridine diphosphate-N-acetylglucosamine SMILES CC(CCO)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C Uridine 5'-monophosphate Uridine diphosphate glucose 17372 ChemSpider C00381 KEGG Compound C102H170N2O22P2 Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol 1837.172 2.7.1.108 false 2.7.1.108 Cytidine triphosphate + Dolichol-20 → CDP + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT C9H16N3O14P3 Cytidine triphosphate 482.9845 4444045 ChemSpider H Hydrogen Ion 1.007825 C00029 KEGG Compound 1.0 220496-27-5 CAS SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O[C@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 1.0 6433320 PubChem-compound 1.0 1.0 SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O N-Glycan Biosynthesis C01246 KEGG Compound C00035 KEGG Compound SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O)[C@@H]1O CHEBI:16091 ChEBI SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 Reaction7070 false (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT P53178 UniProt 2.4.1.117 false 2.4.1.117 Dolichol phosphate + Uridine diphosphate glucose → UDP + Dolichyl b-D-glucosyl phosphate LEFT_TO_RIGHT 2.4.1.267 false 2.4.1.267 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → Dolichol phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7034 ACTIVATION P53730 UniProt 2.4.1.256 false 2.4.1.256 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.265 false 2.4.1.265 Dolichyl b-D-glucosyl phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol → (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 1.0 (C5H8)nC10H21O4P Dolichol phosphate C00043 KEGG Compound 1.0 58-97-9 CAS 1.0 P16661 UniProt ReactionCatalysis7038 ACTIVATION 2.4.1.258 false 2.4.1.258 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.83 false 2.4.1.83 Dolichol phosphate + Guanosine diphosphate mannose → Guanosine diphosphate + dolichyl β-D-mannosyl phosphate LEFT_TO_RIGHT 2.4.1.260 false 2.4.1.260 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.259,2.4.1.261 false 2.4.1.259,2.4.1.261 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7039 ACTIVATION dolichol kinase 5902 ChemSpider ReactionCatalysis7041 ACTIVATION PW002501 PathWhiz ReactionCatalysis7040 ACTIVATION UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase ReactionCatalysis7045 ACTIVATION ReactionCatalysis7044 ACTIVATION ReactionCatalysis7043 ACTIVATION ReactionCatalysis7042 ACTIVATION P07286 UniProt HMDB01163 HMDB Dolichol phosphate 22833557 PubChem-compound C00063 KEGG Compound C9H15N3O11P2 CDP 403.0182 C00110 KEGG Compound Dolichol-phosphate mannosyltransferase ReactionCatalysis7049 ACTIVATION GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase ReactionCatalysis7048 ACTIVATION ReactionCatalysis7047 ACTIVATION ALPHA-D-MANNOSYLCHITOBIO BioCyc Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase ReactionCatalysis7046 ACTIVATION UDP-N-acetylglucosamine transferase subunit ALG14 UDP-N-acetylglucosamine transferase Alg13p subunit Alpha-1,3/1,6-mannosyltransferase ALG2 Chitobiosyldiphosphodolichol beta-mannosyltransferase Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase ReactionCatalysis7052 ACTIVATION Alpha-1,2-mannosyltransferase ALG9 ReactionCatalysis7051 ACTIVATION Dolichyl-phosphate beta-glucosyltransferase ReactionCatalysis7050 ACTIVATION N-acetyl-α-D-glucosaminyl-diphosphodolichol Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase 445675 PubChem-compound P53954 UniProt HMDB00082 HMDB UDP-N-ACETYL-D-GLUCOSAMINE BioCyc 1.0 8977 PubChem-compound SMILES OC[C@H]1O[C@@H](OP(=O)(O)OCCC(C)CC\C=C(\C)CCC=C(C)C)[C@H](O)[C@@H](O)[C@@H]1O HMDB01054 HMDB (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol dolichyl β-D-mannosyl phosphate P14020 UniProt 65-47-4 CAS 1.0 1.0 Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase C16H25N5O16P2 Guanosine diphosphate mannose 605.07715 Guanosine diphosphate HMDB00290 HMDB 8630 ChemSpider CHEBI:16695 ChEBI CPD-171 BioCyc C00080 KEGG Compound (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol (N-Acetylglucosaminyl)2-diphosphodolichol (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol C100H164O Dolichol-20 1381.2782 SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 1.0 5808 ChemSpider 1.0 CHEBI:17677 ChEBI CPD-5169 BioCyc 6176 PubChem-compound CHEBI:15378 ChEBI SMILES [H+] CHEBI:15812 ChEBI CHEBI:17552 ChEBI CPD-5167 BioCyc CPD-5166 BioCyc CPD-5165 BioCyc (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 3123-67-9 CAS 1.0 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol C00096 KEGG Compound CPD-5170 BioCyc C108H180N2O27P2 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 1999.2249 C162H270N2O72P2 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3457.7002 53481393 PubChem-compound 53481395 PubChem-compound Q12001 UniProt 5941 ChemSpider 2.0 Dolichol-20 1.0 SMILES CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(=O)NC1=O 18396 PubChem-compound SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)N1C=CC(=O)NC1=O 4938490 ChemSpider SMILES OC[C@@H]1OC(OP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)N2C=CC(=O)NC2=O)[C@@H](O)[C@H](O)[C@H]1O P50076 UniProt 1.0 2.0 HMDB00288 HMDB UMP BioCyc 1.0 HMDB05176 HMDB Guanosine diphosphate mannose HMDB00286 HMDB Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 146-91-8 CAS 17216044 ChemSpider C156H260N2O67P2 Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3295.6475 34457-14-2 CAS HMDB12255 HMDB dolichol kinase UDP-N- acetylglucosamine- -dolichyl- phosphate N- acetylglucosaminephosphotransferase UDP-N- acetylglucosamine transferase Alg13p subunit UDP-N- acetylglucosamine transferase subunit ALG14 Chitobiosyldiphosphodolichol beta- mannosyltransferase Dolichol- phosphate mannosyltransferase Alpha- 1,3/1,6- mannosyltransferase ALG2 Alpha- 1,3/1,6- mannosyltransferase ALG2 GDP- Man:Man(3)GlcNAc(2)- PP-Dol alpha-1,2- mannosyltransferase Dol-P- Man:Man(5)GlcNAc(2)- PP-Dol alpha-1,3- mannosyltransferase Alpha-1,2- mannosyltransferase ALG9 Dol-P- Man:Man(7)GlcNAc(2)- PP-Dol alpha-1,6- mannosyltransferase Alpha-1,2- mannosyltransferase ALG9 Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3- glucosyltransferase Dolichyl- phosphate beta- glucosyltransferase Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3- glucosyltransferase Dol-P- Glc:Glc(2)Man(9)GlcNAc(2)- PP-Dol alpha-1,2- glucosyltransferase Dolichol-20 Cytidine triphosphate Dolichol phosphate H + CDP Uridine diphosphate- N- acetylglucosamine Uridine 5'- monophosphate N-acetyl-α-D- glucosaminyl- diphosphodolichol Uridine diphosphate- N- acetylglucosamine (N- Acetylglucosaminyl)2- diphosphodolichol UDP H + Guanosine diphosphate mannose Mannosyl-(N- acetylglucosaminyl)2- diphosphodolichol GDP H + Guanosine diphosphate mannose Dolichol phosphate GDP dolichyl β-D-mannosyl phosphate Guanosine diphosphate mannose (Mannosyl)2- (N- acetylglucosaminyl)2- diphosphodolichol GDP H + Guanosine diphosphate mannose GDP H + (Mannosyl)3- (N- acetylglucosaminyl)2- diphosphodolichol Guanosine diphosphate mannose (Mannosyl)5- (N- acetylglucosaminyl)2- diphosphodolichol GDP H + dolichyl β-D-mannosyl phosphate Dolichol phosphate H + (Mannosyl)6- (N- acetylglucosaminyl)2- diphosphodolichol dolichyl β-D-mannosyl phosphate (Mannosyl)7- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + dolichyl β-D-mannosyl phosphate (Mannosyl)8- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + dolichyl β-D-mannosyl phosphate (Mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + Dolichyl b-D-glucosyl phosphate Glucosyl- (mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + Uridine diphosphate glucose Dolichol phosphate UDP Dolichyl b-D-glucosyl phosphate (Glucosyl)2(mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol Dolichol phosphate H + Dolichyl b-D-glucosyl phosphate H + Dolichol phosphate (glucosyl)3(mannosyl)9- (N- acetylglucosaminyl)2- diphosphodolichol
1.0 53481369 PubChem-compound HMDB06353 HMDB Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol HMDB12122 HMDB HMDB12121 HMDB Cytidine triphosphate HMDB12126 HMDB HMDB12125 HMDB 1.0 HMDB12124 HMDB HMDB12123 HMDB 6132 PubChem-compound CHEBI:17239 ChEBI UDP C21H39O9P Dolichyl b-D-glucosyl phosphate 466.23315 1.0 N-acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase CHEBI:58223 ChEBI CHEBI:16264 ChEBI HMDB12232 HMDB SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 528-04-1 CAS HMDB12119 HMDB HMDB12118 HMDB HMDB12117 HMDB 1.0 63-38-7 CAS HMDB01201 HMDB SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)OP(O)(=O)OC1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])N=C(C)[O-])=C(\C)CCC=C(C)C C9H14N2O12P2 UDP 404.0022 Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase CHEBI:15820 ChEBI Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Dolichyl b-D-glucosyl phosphate Dolichyl-phosphate beta-glucosyltransferase 1038 PubChem-compound Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase 1.0 SMILES CC(CCOP([O-])(=O)OP([O-])(=O)OC1OC(CO)C(OC2OC(CO)C(OC3OC(COC4OC(COC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C(O)C(OC5OC(CO)C(O)C(O)C5OC5OC(CO)C(O)C(O)C5O)C4O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(OC5OC(CO)C(O)C(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)C5O)C4O)C3O)C(O)C2NC(C)=O)C(O)C1NC(C)=O)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C NN-DIACETYLCHITOBIOSYLDIPHOSPHODOLICHO BioCyc SMILES [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC\C(C)=C(\[H])CC[C@]([H])(C)CCOP([O-])(=O)O[C@]1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@]1([H])O)=C(\C)CCC=C(C)C Alpha-1,2-mannosyltransferase ALG9 P40351 UniProt C96H160N2O17P2 (N-Acetylglucosaminyl)2-diphosphodolichol 1675.1193 P40350 UniProt C150H250N2O62P2 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3133.5947 C144H240N2O57P2 (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol 2971.5417 HMDB59597 HMDB C114H190N2O32P2 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 2161.2776 C138H230N2O52P2 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol 2809.489 C132H220N2O47P2 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol 2647.4363 393240 ChemSpider C126H210N2O42P2 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol 2485.3833 Dolichol-phosphate mannosyltransferase Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase C04537 KEGG Compound C00105 KEGG Compound 6030 PubChem-compound UDP-N-acetylglucosamine transferase subunit ALG14 53481378 PubChem-compound 53477679 PubChem-compound Chitobiosyldiphosphodolichol beta-mannosyltransferase 2067-66-5 CAS Alpha-1,3/1,6-mannosyltransferase ALG2 GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase 133-89-1 CAS dolichol kinase UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase UDP-N-acetylglucosamine transferase Alg13p subunit 1010 ChemSpider C10H15N5O11P2 Guanosine diphosphate 443.02432 53481374 PubChem-compound 53481375 PubChem-compound P43636 UniProt P38179 UniProt 53481376 PubChem-compound 53481377 PubChem-compound 53481370 PubChem-compound 53481371 PubChem-compound 53481373 PubChem-compound 1.0 HMDB01546 HMDB Hydrogen Ion C88H145NO12P2 N-acetyl-α-D-glucosaminyl-diphosphodolichol 1470.0253 C168H278N2O77P2 (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3617.7385 C86H142O9P dolichyl β-D-mannosyl phosphate 1350.0397 C00112 KEGG Compound C15H24N2O17P2 Uridine diphosphate glucose 566.055 UDP-GLUCOSE BioCyc P20048 UniProt CDP 5280322 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 1.0 SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H](NC(C)=O)[C@@H](O)[C@@H]1O http://identifiers.org/smpdb/SMP02400 SMPDB SMILES OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O 25245072 PubChem-compound SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H]3O)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O C17H27N3O17P2 Uridine diphosphate-N-acetylglucosamine 607.08154 1.0 C9H13N2O9P Uridine 5'-monophosphate 324.03586 P38242 UniProt GDP-MANNOSE BioCyc CTP BioCyc SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE BioCyc CDP BioCyc 2.4.1.141 false 2.4.1.141 N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine diphosphate-N-acetylglucosamine ? UDP + (N-Acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion 2.7.8.15 false 2.7.8.15 Dolichol phosphate + Uridine diphosphate-N-acetylglucosamine → N-acetyl-α-D-glucosaminyl-diphosphodolichol + Uridine 5'-monophosphate LEFT_TO_RIGHT 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 Guanosine diphosphate mannose + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol → (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.142 false 2.4.1.142 (N-Acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → Guanosine diphosphate + Hydrogen Ion + Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol LEFT_TO_RIGHT 2.4.1.131 false 2.4.1.131 (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + 2 Guanosine diphosphate + 2 Hydrogen Ion LEFT_TO_RIGHT 1.0 2.4.1.132,2.4.1.257 false 2.4.1.132,2.4.1.257 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate mannose → (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol + Guanosine diphosphate + Hydrogen Ion LEFT_TO_RIGHT P53868 UniProt 25245534 PubChem-compound SMILES NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C(=O)N1 Uridine diphosphate-N-acetylglucosamine SMILES CC(CCO)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C Uridine 5'-monophosphate Uridine diphosphate glucose 17372 ChemSpider C00381 KEGG Compound C102H170N2O22P2 Mannosyl-(N-acetylglucosaminyl)2-diphosphodolichol 1837.172 2.7.1.108 false 2.7.1.108 Cytidine triphosphate + Dolichol-20 → CDP + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT C9H16N3O14P3 Cytidine triphosphate 482.9845 4444045 ChemSpider H Hydrogen Ion 1.007825 C00029 KEGG Compound 1.0 220496-27-5 CAS SMILES OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)O[C@H]3[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]3CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@H]3O[C@@H](O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)O[C@H]4[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]4CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O[C@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@H]5O)[C@@H]4O)[C@@H]3O)[C@@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)[C@@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O 1.0 6433320 PubChem-compound 1.0 1.0 SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O N-Glycan Biosynthesis C01246 KEGG Compound C00035 KEGG Compound SMILES OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)OP(=O)(O)OP(=O)(O)OCCC(C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)[C@@H](O)[C@@H](O)[C@@H]1O CHEBI:16091 ChEBI SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 Reaction7070 false (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT P53178 UniProt 2.4.1.117 false 2.4.1.117 Dolichol phosphate + Uridine diphosphate glucose → UDP + Dolichyl b-D-glucosyl phosphate LEFT_TO_RIGHT 2.4.1.267 false 2.4.1.267 (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → Dolichol phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7034 ACTIVATION P53730 UniProt 2.4.1.256 false 2.4.1.256 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichyl b-D-glucosyl phosphate → (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.265 false 2.4.1.265 Dolichyl b-D-glucosyl phosphate + Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol → (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 1.0 (C5H8)nC10H21O4P Dolichol phosphate C00043 KEGG Compound 1.0 58-97-9 CAS 1.0 P16661 UniProt ReactionCatalysis7038 ACTIVATION 2.4.1.258 false 2.4.1.258 (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.83 false 2.4.1.83 Dolichol phosphate + Guanosine diphosphate mannose → Guanosine diphosphate + dolichyl β-D-mannosyl phosphate LEFT_TO_RIGHT 2.4.1.260 false 2.4.1.260 (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT 2.4.1.259,2.4.1.261 false 2.4.1.259,2.4.1.261 (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol + dolichyl β-D-mannosyl phosphate → (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol + Dolichol phosphate + Hydrogen Ion LEFT_TO_RIGHT ReactionCatalysis7039 ACTIVATION dolichol kinase 5902 ChemSpider ReactionCatalysis7041 ACTIVATION PW002501 PathWhiz ReactionCatalysis7040 ACTIVATION UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase ReactionCatalysis7045 ACTIVATION ReactionCatalysis7044 ACTIVATION ReactionCatalysis7043 ACTIVATION ReactionCatalysis7042 ACTIVATION P07286 UniProt HMDB01163 HMDB Dolichol phosphate 22833557 PubChem-compound C00063 KEGG Compound C9H15N3O11P2 CDP 403.0182 C00110 KEGG Compound Dolichol-phosphate mannosyltransferase ReactionCatalysis7049 ACTIVATION GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase ReactionCatalysis7048 ACTIVATION ReactionCatalysis7047 ACTIVATION ALPHA-D-MANNOSYLCHITOBIO BioCyc Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase ReactionCatalysis7046 ACTIVATION UDP-N-acetylglucosamine transferase subunit ALG14 UDP-N-acetylglucosamine transferase Alg13p subunit Alpha-1,3/1,6-mannosyltransferase ALG2 Chitobiosyldiphosphodolichol beta-mannosyltransferase Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase ReactionCatalysis7052 ACTIVATION Alpha-1,2-mannosyltransferase ALG9 ReactionCatalysis7051 ACTIVATION Dolichyl-phosphate beta-glucosyltransferase ReactionCatalysis7050 ACTIVATION N-acetyl-α-D-glucosaminyl-diphosphodolichol Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase 445675 PubChem-compound P53954 UniProt HMDB00082 HMDB UDP-N-ACETYL-D-GLUCOSAMINE BioCyc 1.0 8977 PubChem-compound SMILES OC[C@H]1O[C@@H](OP(=O)(O)OCCC(C)CC\C=C(\C)CCC=C(C)C)[C@H](O)[C@@H](O)[C@@H]1O HMDB01054 HMDB (glucosyl)3(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol dolichyl β-D-mannosyl phosphate P14020 UniProt 65-47-4 CAS 1.0 1.0 Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase C16H25N5O16P2 Guanosine diphosphate mannose 605.07715 Guanosine diphosphate HMDB00290 HMDB 8630 ChemSpider CHEBI:16695 ChEBI CPD-171 BioCyc C00080 KEGG Compound (Mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol (N-Acetylglucosaminyl)2-diphosphodolichol (Mannosyl)7-(N-acetylglucosaminyl)2-diphosphodolichol C100H164O Dolichol-20 1381.2782 SMILES NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O (Mannosyl)8-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)5-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)6-(N-acetylglucosaminyl)2-diphosphodolichol (Mannosyl)3-(N-acetylglucosaminyl)2-diphosphodolichol 1.0 5808 ChemSpider 1.0 CHEBI:17677 ChEBI CPD-5169 BioCyc 6176 PubChem-compound CHEBI:15378 ChEBI SMILES [H+] CHEBI:15812 ChEBI CHEBI:17552 ChEBI CPD-5167 BioCyc CPD-5166 BioCyc CPD-5165 BioCyc (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 3123-67-9 CAS 1.0 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol C00096 KEGG Compound CPD-5170 BioCyc C108H180N2O27P2 (Mannosyl)2-(N-acetylglucosaminyl)2-diphosphodolichol 1999.2249 C162H270N2O72P2 (Glucosyl)2(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3457.7002 53481393 PubChem-compound 53481395 PubChem-compound Q12001 UniProt 5941 ChemSpider 2.0 Dolichol-20 1.0 SMILES CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(=O)NC1=O 18396 PubChem-compound SMILES O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)N1C=CC(=O)NC1=O 4938490 ChemSpider SMILES OC[C@@H]1OC(OP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)N2C=CC(=O)NC2=O)[C@@H](O)[C@H](O)[C@H]1O P50076 UniProt 1.0 2.0 HMDB00288 HMDB UMP BioCyc 1.0 HMDB05176 HMDB Guanosine diphosphate mannose HMDB00286 HMDB Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 146-91-8 CAS 17216044 ChemSpider C156H260N2O67P2 Glucosyl-(mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol 3295.6475 34457-14-2 CAS HMDB12255 HMDB