Quantitative metabolomics services for biomarker discovery and validation.
Specializing in ready to use metabolomics kits.
Your source for quantitative metabolomics technologies and bioinformatics.

Loading Pathway...

PKA-PKC Citrulline Glutamate [NMDA] receptor subunit epsilon-1 P62158 UniProt SMILES N[C@@H](CCCNC(N)=O)C(O)=O 127983 ChemSpider Protein kinase C alpha type 9367 ChemSpider direct_interaction Calcium Nitric oxide C6H14N4O2 L-Arginine 174.11168 C00327 KEGG Compound 6992098 PubChem-compound Glutamate [NMDA] receptor subunit 3A Interaction746 Citrulline activates Nitric-oxide synthase, brain NITRIC-OXIDE BioCyc Interaction748 Nitric-oxide synthase, brain activates L-Arginine Interaction747 Nitric-oxide synthase, brain activates Nitric oxide HMDB0003378 HMDB SMP0063777 SMPDB Cytoplasm Q12879 UniProt Q8TCU5 UniProt Disks large homolog 4 P29475 UniProt Protein kinase C alpha type Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Disks large homolog 4 1.0 Homo sapiens 1.0 SMILES N[C@@H](CCCNC(N)=N)C(O)=O C00062 KEGG Compound TransportCatalysis977 ACTIVATION 28782 PubChem-compound Nitric Oxide Signaling Pathway ARG BioCyc L-Arginine L-CITRULLINE BioCyc CHEBI:16480 ChEBI NO Nitric oxide 29.997988 cAMP-dependent protein kinase catalytic subunit beta Glutamate receptor ionotropic Nitric-oxide synthase, brain 266 ChemSpider P17252 UniProt 9606 TAXONOMY Glutamate [NMDA] receptor subunit zeta-1 145068 PubChem-compound C00076 KEGG Compound Calmodulin Q08209 UniProt CA%2b2 BioCyc Glutamate [NMDA] receptor subunit 3A PW064769 PathWhiz Ca Calcium 39.96259 1.0 CHEBI:16467 ChEBI CHEBI:16349 ChEBI SMILES [N]=O P22694 UniProt Q05586 UniProt Glutamate [NMDA] receptor subunit epsilon-1 271 PubChem-compound HMDB0000464 HMDB Nitric oxide synthase, brain Interaction391 Nitric-oxide synthase, brain activates Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform 1.0 Interaction390 Disks large homolog 4 activates Nitric-oxide synthase, brain Interaction393 PKA-PKC activates Nitric-oxide synthase, brain Interaction392 Calmodulin activates Nitric-oxide synthase, brain Interaction395 Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform activates Nitric-oxide synthase, brain Transport1158 false Calcium (→) Transport: Homo sapiens, Extracellular Space to Homo sapiens, Cell, Cytoplasm LEFT_TO_RIGHT 2.0 C6H13N3O3 Citrulline 175.09569 372-75-8 CAS C00533 KEGG Compound HMDB0000904 HMDB Extracellular Space 10102-43-9 CAS 6082 ChemSpider 14127-61-8 CAS SMILES [Ca++] P78352 UniProt Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Calcium 74-79-3 CAS Calmodulin cAMP-dependent protein kinase catalytic subunit beta HMDB0000517 HMDB Glutamate [NMDA] receptor subunit zeta-1 GO:0005615 GENE ONTOLOGY CHEBI:29108 ChEBI GO:0005737 GENE ONTOLOGY 1.0 Nitric oxide synthase, brain Calmodulin Disks large homolog 4 Nitric oxide synthase, brain Calmodulin Serine/threonine- protein phosphatase 2B catalytic subunit alpha isoform Protein kinase C alpha type cAMP-dependent protein kinase catalytic subunit beta Nitric oxide synthase, brain Glutamate [NMDA] receptor subunit zeta-1 Glutamate [NMDA] receptor subunit epsilon-1 Glutamate [NMDA] receptor subunit 3A Citrulline NO L-Arginine Ca + Ca + Ca + Ca + Ca + P i P i Ca + Ca + cCMP Regulation Long-Term Potentiation Neurotransmission Extracellular Cytoplasm
PKA-PKC Citrulline Glutamate [NMDA] receptor subunit epsilon-1 P62158 UniProt SMILES N[C@@H](CCCNC(N)=O)C(O)=O 127983 ChemSpider Protein kinase C alpha type 9367 ChemSpider direct_interaction Calcium Nitric oxide C6H14N4O2 L-Arginine 174.11168 C00327 KEGG Compound 6992098 PubChem-compound Glutamate [NMDA] receptor subunit 3A Interaction746 Citrulline activates Nitric-oxide synthase, brain NITRIC-OXIDE BioCyc Interaction748 Nitric-oxide synthase, brain activates L-Arginine Interaction747 Nitric-oxide synthase, brain activates Nitric oxide HMDB0003378 HMDB SMP0063777 SMPDB Cytoplasm Q12879 UniProt Q8TCU5 UniProt Disks large homolog 4 P29475 UniProt Protein kinase C alpha type Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Disks large homolog 4 1.0 Homo sapiens 1.0 SMILES N[C@@H](CCCNC(N)=N)C(O)=O C00062 KEGG Compound TransportCatalysis977 ACTIVATION 28782 PubChem-compound Nitric Oxide Signaling Pathway ARG BioCyc L-Arginine L-CITRULLINE BioCyc CHEBI:16480 ChEBI NO Nitric oxide 29.997988 cAMP-dependent protein kinase catalytic subunit beta Glutamate receptor ionotropic Nitric-oxide synthase, brain 266 ChemSpider P17252 UniProt 9606 TAXONOMY Glutamate [NMDA] receptor subunit zeta-1 145068 PubChem-compound C00076 KEGG Compound Calmodulin Q08209 UniProt CA%2b2 BioCyc Glutamate [NMDA] receptor subunit 3A PW064769 PathWhiz Ca Calcium 39.96259 1.0 CHEBI:16467 ChEBI CHEBI:16349 ChEBI SMILES [N]=O P22694 UniProt Q05586 UniProt Glutamate [NMDA] receptor subunit epsilon-1 271 PubChem-compound HMDB0000464 HMDB Nitric oxide synthase, brain Interaction391 Nitric-oxide synthase, brain activates Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform 1.0 Interaction390 Disks large homolog 4 activates Nitric-oxide synthase, brain Interaction393 PKA-PKC activates Nitric-oxide synthase, brain Interaction392 Calmodulin activates Nitric-oxide synthase, brain Interaction395 Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform activates Nitric-oxide synthase, brain Transport1158 false Calcium (→) Transport: Homo sapiens, Extracellular Space to Homo sapiens, Cell, Cytoplasm LEFT_TO_RIGHT 2.0 C6H13N3O3 Citrulline 175.09569 372-75-8 CAS C00533 KEGG Compound HMDB0000904 HMDB Extracellular Space 10102-43-9 CAS 6082 ChemSpider 14127-61-8 CAS SMILES [Ca++] P78352 UniProt Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Calcium 74-79-3 CAS Calmodulin cAMP-dependent protein kinase catalytic subunit beta HMDB0000517 HMDB Glutamate [NMDA] receptor subunit zeta-1 GO:0005615 GENE ONTOLOGY CHEBI:29108 ChEBI GO:0005737 GENE ONTOLOGY 1.0 Nitric oxide synthase, brain CALM1 DLG4 NOS1 CALM1 PPP3CA PRKCA PRKACB NOS1 GRIN1 GRIN2A GRIN3A Citrulline Nitric oxide L-Arginine Calcium Calcium Calcium Calcium Calcium Phosphate Phosphate Calcium Calcium