Loading Pathway...
HMDB00015 HMDB 82579 ChemSpider HMDB00016 HMDB 1.0 937 ChemSpider 3a-Hydroxy-5b-pregnane-20-one 17a,21-Dihydroxypreg-nenolone HMDB00253 HMDB HMDB00374 HMDB CHOLESTEROL BioCyc 1.1.1.- false 1.1.1.- Cortisol + NADP → Cortisone + Hydrogen Ion + NADPH LEFT_TO_RIGHT 1.0 1.14.99.10 false 1.14.99.10 21-Deoxycortisol + Oxygen + Reduced acceptor → Acceptor + Cortisol + Water LEFT_TO_RIGHT 439153 PubChem-compound ReactionCatalysis948 ACTIVATION SMP00023 SMPDB 1.0 ReactionCatalysis947 ACTIVATION 83782 ChemSpider 1.14.15.4 false 1.14.15.4 Deoxycorticosterone + Oxygen + Reduced adrenal ferredoxin → Corticosterone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT ReactionCatalysis943 ACTIVATION 53477897 PubChem-compound 53477896 PubChem-compound HMDB00268 HMDB 1.0 53477898 PubChem-compound 1.0 Cytochrome P450 11B2, mitochondrial 389571 ChemSpider NADPH PW000050 PathWhiz 1.0 1.0 216208 ChemSpider 11b,17a,21-Trihydroxypreg-nenolone 600-57-7 CAS 1.14.99.10 false 1.14.99.10 11b-Hydroxyprogesterone + Oxygen + Reduced acceptor → Acceptor + Corticosterone + Water LEFT_TO_RIGHT Reaction1245 false 21-Deoxycortisol + Acceptor + Water → 11b-Hydroxyprogesterone + Oxygen + Reduced acceptor LEFT_TO_RIGHT 1.0 ReactionCatalysis971 ACTIVATION 6166 PubChem-compound 11b,21-Dihydroxy-5b-pregnane-3,20-dione 1164-98-3 CAS 24779614 PubChem-compound C05475 KEGG Compound 1.0 C01780 KEGG Compound PREGNENOLONE BioCyc 1.0 CHEBI:16474 ChEBI Hydrogen Ion CHEBI:15022 ChEBI Progesterone 952 ChemSpider 1.14.15.4 false 1.14.15.4 Cortexolone + Oxygen + Reduced adrenal ferredoxin → Cortisol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.14.15.4 false 1.14.15.4 17-Hydroxyprogesterone + Oxygen + Reduced adrenal ferredoxin → 21-Deoxycortisol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT HMDB59597 HMDB HMDB01318 HMDB ReactionCatalysis964 ACTIVATION Reaction1279 false Oxygen + Progesterone + Reduced acceptor → 17-Hydroxyprogesterone + Acceptor + Water LEFT_TO_RIGHT 1.0 53477676 PubChem-compound 53477678 PubChem-compound HMDB03759 HMDB 68-54-2 CAS 1.0 2.0 167685 PubChem-compound 1010 ChemSpider CHEBI:16485 ChEBI HMDB00363 HMDB 1.14.99.10 false 1.14.99.10 Oxygen + Progesterone + Reduced acceptor → Acceptor + Deoxycorticosterone + Water LEFT_TO_RIGHT ReactionCatalysis957 ACTIVATION ReactionCatalysis956 ACTIVATION 1.0 1.14.99.10 false 1.14.99.10 Oxygen + Pregnenolone + Reduced acceptor → 21-Hydroxypregnenolone + Acceptor + Water LEFT_TO_RIGHT Reaction1267 false Oxygen + Progesterone + Reduced adrenal ferredoxin → 11b-Hydroxyprogesterone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT ReactionCatalysis993 ACTIVATION CHEBI:17026 ChEBI ReactionCatalysis991 ACTIVATION 1.0 1.0 1.0 20A-HYDROXY-CHOLESTEROL BioCyc HMDB00217 HMDB HMDB01547 HMDB 24774738 ChemSpider Transport69 false Progesterone (→) Transport: Homo sapiens, Cell, Endoplasmic Reticulum to Homo sapiens, Cell, Cytoplasm LEFT_TO_RIGHT Tetrahydrocortisol 1.14.15.6 false 1.14.15.6 20alpha-Hydroxycholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 20a,22b-Dihydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.14.15.6 false 1.14.15.6 Cholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 22b-Hydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.0 1.14.15.6 false 1.14.15.6 22b-Hydroxycholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 20a,22b-Dihydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.14.15.6 false 1.14.15.6 17a,20a-Dihydroxycholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 17a-Hydroxypregnenolone + 4-Methylpentanal + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT 1.0 CHEBI:28043 ChEBI 1.14.15.6 false 1.14.15.6 Cholesterol + Hydrogen Ion + Oxygen + Reduced adrenal ferredoxin → 20alpha-Hydroxycholesterol + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT ReactionCatalysis985 ACTIVATION 21506239 ChemSpider HMDB00221 HMDB 1.0 ReactionCatalysis983 ACTIVATION C00007 KEGG Compound C21H34O5 Tetrahydrocortisol 366.24063 C00006 KEGG Compound ReactionCatalysis981 ACTIVATION 566-65-4 CAS CHEBI:18009 ChEBI C00001 KEGG Compound NADP C21H32O2 5a-Pregnane-3,20-dione 316.24023 C00005 KEGG Compound 1.0 C00004 KEGG Compound C00003 KEGG Compound NADP 1.14.99.10 false 1.14.99.10 17a-Hydroxypregnenolone + Hydrogen Ion + NADPH + Oxygen ↔ 17a,21-Dihydroxypreg-nenolone + NADP + Water REVERSIBLE Steroid 21-hydroxylase Reaction1284 false Oxygen + Pregnenolone + Reduced acceptor → 17a-Hydroxypregnenolone + Acceptor + Water LEFT_TO_RIGHT 5a-Pregnane-3,20-dione 1.14.99.10 false 1.14.99.10 17-Hydroxyprogesterone + Oxygen + Reduced acceptor → Acceptor + Cortexolone + Water LEFT_TO_RIGHT 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al 22b-Hydroxycholesterol ReactionCatalysis975 ACTIVATION 17a-Hydroxypregnenolone 57-88-5 CAS 1.0 Corticosterone ReactionCatalysis974 ACTIVATION 1.14.15.6 false 1.14.15.6 20a,22b-Dihydroxycholesterol + 2 Hydrogen Ion + Oxygen + 2 Reduced adrenal ferredoxin → 4-Methylpentanal + 2 Oxidized adrenal ferredoxin + Pregnenolone + 2 Water LEFT_TO_RIGHT C21H32O5 3a,11b,21-Trihydroxy-20-oxo-5b-pregnan-18-al 364.22498 BiologicalState49 C21H32O5 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al 364.22498 Aldo-keto reductase family 1 member C4 C21H32O4 3a,21-Dihydroxy-5b-pregnane-11,20-dione 348.23007 15234-55-6 CAS C21H30O4 21-Hydroxy-5b-pregnane-3,11,20-trione 346.21442 C21H32O5 Tetrahydrocortisone 364.22498 1.0 C21H28N7O14P2 NAD 664.11694 Deoxycorticosterone 11-Dehydrocorticosterone Oxygen 1.0 NAD(P) BioCyc 1.0 P05108 UniProt 1.0 C27H46O3 17a,20a-Dihydroxycholesterol 418.3447 11222 PubChem-compound H Hydrogen Ion 1.007825 C21H28O5 Cortisone 360.19366 72-23-1 CAS 5773 ChemSpider CHEBI:17252 ChEBI C21H32O4 11b,21-Dihydroxy-5b-pregnane-3,20-dione 348.23007 6238 PubChem-compound Cholesterol side-chain cleavage enzyme, mitochondrial 53-84-9 CAS C21H30O5 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione 362.20932 C21H32O5 Dihydrocortisol 364.22498 C21H34O2 3a-Hydroxy-5b-pregnane-20-one 318.2559 C21H32O5 11b,17a,21-Trihydroxypreg-nenolone 364.22498 C21H32O4 17a,21-Dihydroxypreg-nenolone 348.23007 17a-Hydroxypregnenolone C27H46O3 20a,22b-Dihydroxycholesterol 418.3447 HMDB00319 HMDB ReactionCatalysis999 ACTIVATION P14060 UniProt ReactionCatalysis998 ACTIVATION ReactionCatalysis995 ACTIVATION ReactionCatalysis996 ACTIVATION 44263339 PubChem-compound 1.0 20alpha-Hydroxycholesterol CL:0000000 CELL TYPE ONTOLOGY C01124 KEGG Compound SMILES NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O SMILES [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])C2CC=C2C[C@H](O)CC[C@]12C 1.0 13783449 PubChem-compound 657311 PubChem-compound 1.0 P17516 UniProt 17-Hydroxyprogesterone 1.0 C05499 KEGG Compound 1.0 C03681 KEGG Compound Cytochrome P450 11B1, mitochondrial Progesterone 1.0 1.0 SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])C2CC[C@]2([H])C[C@H](O)CC[C@]12C Progesterone SMP00566 SMPDB Pregnenolone C05502 KEGG Compound C03205 KEGG Compound 17a,20a-Dihydroxycholesterol 44725717 PubChem-compound 7732-18-5 CAS 571435 ChemSpider Cholesterol side-chain cleavage enzyme, mitochondrial C27H46O2 20alpha-Hydroxycholesterol 402.3498 1.0 C05501 KEGG Compound C05500 KEGG Compound Water SMILES [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C Corticosteroid 11-beta-dehydrogenase isozyme 2 Corticosteroid 11-beta-dehydrogenase isozyme 1 24850110 ChemSpider 1167-48-2 CAS 247020 PubChem-compound 4-METHYLPENTANAL BioCyc Corticosteroid 11-beta-dehydrogenase isozyme 2 Corticosteroid 11-beta-dehydrogenase isozyme 1 44263345 PubChem-compound 1.0 44263347 PubChem-compound 68-96-2 CAS 1.0 1.0 C00187 KEGG Compound BiologicalState18 C02373 KEGG Compound SMILES CC(C)CCC=O 1.0 SMILES [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2CC(O)CC[C@]12C SMILES [H][C@@]12CC[C@@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C 18-Hydroxycorticosterone 44263342 PubChem-compound 24850104 ChemSpider 24850108 ChemSpider 52-39-1 CAS 24850107 ChemSpider 962 PubChem-compound Cortexolone 65554 PubChem-compound 1.0 Reduced adrenal ferredoxin Oxidized adrenal ferredoxin 92810 PubChem-compound 1.0 1.0 SMILES [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)C[C@@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C CPD-293 BioCyc C02140 KEGG Compound C00080 KEGG Compound Steroid 17-alpha-hydroxylase/17,20 lyase SMILES O=O 152-58-9 CAS 192735 PubChem-compound Corticosteroid 11-beta-dehydrogenase isozyme 2 1119-16-0 CAS BiologicalState8 P28845 UniProt SMILES [H][C@@]12CC[C@H](C(O)=O)[C@@]1(C)C[C@@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C SMILES [H][C@@]12CC[C@H]([C@H](C)[C@H](O)CCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C BiologicalState3 3a,21-Dihydroxy-5b-pregnane-11,20-dione HMDB01830 HMDB Reduced adrenal ferredoxin HMDB02802 HMDB C01176 KEGG Compound P15538 UniProt 20a,22b-Dihydroxycholesterol NADP HMDB06283 HMDB SMILES [H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@]([H])(O)C[C@]12C)C(=O)CO 68-42-8 CAS Oxidized adrenal ferredoxin Dihydrocortisol 17a,21-Dihydroxypreg-nenolone 3-oxo-5-beta-steroid 4-dehydrogenase CPD-272 BioCyc 21-Deoxycortisol 1.0 1.0 22833512 PubChem-compound Cytochrome P450 11B1, mitochondrial 144508 ChemSpider H2O Water 18.010565 NADH BioCyc ReactionCatalysis921 ACTIVATION HMDB00949 HMDB 2.0 NAD BioCyc 977 PubChem-compound NADPH 50-23-7 CAS 5932 ChemSpider CPD-286 BioCyc 11b,17a,21-Trihydroxypreg-nenolone 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione Steroid 17-alpha-hydroxylase/17,20 lyase 9863245 PubChem-compound 11b-Hydroxyprogesterone 21-Hydroxy-5b-pregnane-3,11,20-trione SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C P51857 UniProt SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C P26439 UniProt ReactionCatalysis915 ACTIVATION ReactionCatalysis916 ACTIVATION C21H30O5 18-Hydroxycorticosterone 362.20932 ReactionCatalysis911 ACTIVATION ReactionCatalysis912 ACTIVATION 566-01-8 CAS 17215925 ChemSpider 440708 PubChem-compound C21H28O5 Aldosterone 360.19366 129 PubChem-compound Corticosterone CHEBI:27832 ChEBI SMILES O 1.0 C21H30O3 17-Hydroxyprogesterone 330.21948 1.0 21-Hydroxypregnenolone 50-22-6 CAS Cortisol 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase type 1 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase type 2 Steroid 17-alpha-hydroxylase/17,20 lyase 6002 ChemSpider 126 ChemSpider SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(CO)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C C27H46O Cholesterol 386.35486 CHEBI:15846 ChEBI C21H30O5 Cortisol 362.20932 2.0 17954-98-2 CAS P19099 UniProt P80365 UniProt C21H30O4 Cortexolone 346.21442 53-59-8 CAS 1.0 1.0 C05469 KEGG Compound HMDB04030 HMDB C21H30O2 Progesterone 314.22458 1038 PubChem-compound HMDB04031 HMDB 5994 PubChem-compound 5753 PubChem-compound 1.0 HMDB04035 HMDB C05473 KEGG Compound C05472 KEGG Compound C05474 KEGG Compound 2.0 C05471 KEGG Compound CHEBI:18093 ChEBI Hydrogen Ion HMDB00902 HMDB HMDB00903 HMDB C21H30O3 Deoxycorticosterone 330.21948 CHEBI:16906 ChEBI Tetrahydrocortisone CHEBI:16908 ChEBI Tetrahydrocorticosterone 24758425 PubChem-compound 1.0 566-03-0 CAS C05477 KEGG Compound C05476 KEGG Compound 440711 PubChem-compound 53-02-1 CAS C05478 KEGG Compound C05485 KEGG Compound C05480 KEGG Compound Aldosterone C21H30N7O17P3 NADPH 745.0911 C21H29N7O17P3 NADP 744.08325 ALDOSTERONE BioCyc Mitochondrion C21H32O3 17a-Hydroxypregnenolone 332.23514 NADPH BioCyc 1.0 CHEBI:16973 ChEBI Acceptor PW000542 PathWhiz SMILES [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C CPD-6641 BioCyc C05488 KEGG Compound C05487 KEGG Compound Cytochrome P450 11B2, mitochondrial SMILES [H]C12CC[C@](O)(C(=O)CO)[C@@]1(C)CCC1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C C05489 KEGG Compound 58-68-4 CAS SMILES [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C Water 1.0 C05497 KEGG Compound Cortisone 1.0 C05490 KEGG Compound 1.0 HMDB04029 HMDB NADH 21-Deoxycortisol 64-85-7 CAS Oxygen 1.0 C05498 KEGG Compound HMDB04026 HMDB NADPH C05138 KEGG Compound SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O 1.0 SMILES [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C 1.0 1.0 CHEBI:1294 ChEBI CHEBI:28952 ChEBI SMILES C[C@]12CCC(=O)C=C1CCC1C3CC[C@H](C(=O)CO)[C@]3(C[C@H](O)C21)C=O CHEBI:1296 ChEBI SMILES NC(=O)C1=CN(C=CC1)[C@H]1O[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](OP(O)(O)=O)[C@H]2O)N2C=NC3=C(N)N=CN=C23)[C@H](O)[C@@H]1O C21H32O3 21-Hydroxypregnenolone 332.23514 91451 PubChem-compound 53-57-6 CAS Reaction58 false Cortexolone + Hydrogen Ion + NADH ← 17a,21-Dihydroxypreg-nenolone + NAD RIGHT_TO_LEFT Reaction56 false 21-Hydroxypregnenolone + NAD → Deoxycorticosterone + Hydrogen Ion + NADH LEFT_TO_RIGHT 17-Hydroxyprogesterone 17-alpha-hydroxylase deficiency (CYP17) 3a,11b,21-Trihydroxy-20-oxo-5b-pregnan-18-al 10748 ChemSpider C6H12O 4-Methylpentanal 100.08881 16735652 ChemSpider 11-DEOXY-CORTISOL BioCyc Reaction55 false 17a-Hydroxypregnenolone + NAD → 17-Hydroxyprogesterone + Hydrogen Ion + NADH LEFT_TO_RIGHT 222803 PubChem-compound SubPathwayInteraction817 SubPathway817Reaction SubPathwayReaction Reaction52 false NAD + Pregnenolone → Hydrogen Ion + NADH + Progesterone LEFT_TO_RIGHT 1.0 C21H29N7O14P2 NADH 665.12476 Cortisone Aldosterone CHEBI:16827 ChEBI C21H32O2 Pregnenolone 316.24023 1.0 CHEBI:16962 ChEBI Progesterone 24840621 ChemSpider 23141070 ChemSpider 2.0 CHEBI:385115 ChEBI GO:0005739 GENE ONTOLOGY GO:0005737 GENE ONTOLOGY 11025495 PubChem-compound Cortisol 1.0 1.0 1.0 C21H34O4 Tetrahydrocorticosterone 350.2457 HMDB06758 HMDB HMDB06757 HMDB HMDB06756 HMDB HMDB06755 HMDB SMILES CC12CC[C@@H](O)CC1CCC1C3CCC(C(=O)CO)C3(CC(O)C21)C=O SMILES [H][C@@]12CCC(C(=O)CO)C1(CC(O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C)C=O SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C Endoplasmic Reticulum HMDB06759 HMDB Endoplasmic Reticulum Membrane 516-72-3 CAS SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=CN=C3N)[C@@H](O)[C@H]1O HMDB06754 HMDB HMDB06753 HMDB 5682 ChemSpider 11b-Hydroxyprogesterone 222786 PubChem-compound Corticosteroid 11-beta-dehydrogenase isozyme 1 Aldo-keto reductase family 1 member C4 ReactionCatalysis1041 ACTIVATION 1.0 561-65-9 CAS ReactionCatalysis1042 ACTIVATION 11-Dehydrocorticosterone HMDB03259 HMDB 11-DEOXYCORTICOSTERONE BioCyc 167253 ChemSpider SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C 58997 ChemSpider 3-oxo-5-beta-steroid 4-dehydrogenase CHEBI:15339 ChEBI CHEBI:17998 ChEBI ReactionCatalysis1050 ACTIVATION P05093 UniProt SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C SMILES CC12CC(O)C3C(CC=C4CC(O)CCC34C)C1CC[C@]2(O)C(=O)CO SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C HMDB06760 HMDB Reduced acceptor SMILES [H][C@@]12CC[C@]([H])([C@@](C)(O)[C@H](O)CCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2CC(O)CC[C@]12C 5675 ChemSpider SMILES [H]C12CC[C@](O)([C@](C)(O)CCCC(C)C)[C@@]1(C)CCC1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C SMILES [H][C@@]12CCC(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C HMDB06764 HMDB 1.0 HMDB06763 HMDB SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C 5550 ChemSpider HMDB06762 HMDB SMILES [H][C@]12CCC3C4CC[C@H](C(C)=O)[C@@]4(C)CCC3[C@@]1(C)CC[C@@H](O)C2 1.0 4-Methylpentanal NAD ReactionCatalysis1052 ACTIVATION Cytoplasm ReactionCatalysis1051 ACTIVATION NADPH CHEBI:28750 ChEBI Cell C00735 KEGG Compound 1.0 Steroid Biosynthesis SubPathway C21H28O4 11-Dehydrocorticosterone 344.19876 C21H30O4 21-Deoxycortisol 346.21442 Acceptor 388299 ChemSpider Reduced acceptor C27H46O2 22b-Hydroxycholesterol 402.3498 Hydrogen Ion 1.0 O2 Oxygen 31.98983 GO:0005789 GENE ONTOLOGY GO:0005783 GENE ONTOLOGY Deoxycorticosterone C20H28O4 11b-Hydroxyprogesterone 332.19876 C01953 KEGG Compound Cortisol 1.0 53-06-5 CAS 7782-44-7 CAS 1.0 Tetrahydrocorticosterone Cholesterol SubPathwayInput C21H30O4 Corticosterone 346.21442 Reaction1302 false 20alpha-Hydroxycholesterol + Hydrogen Ion + NADPH + Oxygen → 17a,20a-Dihydroxycholesterol + NADP + Water LEFT_TO_RIGHT 1.0 9606 TAXONOMY 1.0 57-83-0 CAS SMILES CC(C)CCC[C@@](C)(O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C 5893 PubChem-compound HMDB02111 HMDB ReactionCatalysis1004 ACTIVATION 1.0 10417-86-4 CAS ReactionCatalysis1006 ACTIVATION ReactionCatalysis1008 ACTIVATION 1.0 Reaction1217 false NADP + Tetrahydrocorticosterone ↔ 11b,21-Dihydroxy-5b-pregnane-3,20-dione + NADPH REVERSIBLE 1.3.1.3 false 1.3.1.3 Hydrogen Ion + NADPH + Progesterone ↔ 5a-Pregnane-3,20-dione + NADP REVERSIBLE Steroid 21-hydroxylase Reaction1337 false 3a-Hydroxy-5b-pregnane-20-one + NADP ↔ 5a-Pregnane-3,20-dione + Hydrogen Ion + NADPH REVERSIBLE 1.0 Reaction1334 false Cortisol + Hydrogen Ion + NADH ↔ 11b,17a,21-Trihydroxypreg-nenolone + NAD REVERSIBLE Reaction1214 true Corticosterone → 11b,21-Dihydroxy-5b-pregnane-3,20-dione LEFT_TO_RIGHT 1.14.15.4 false 1.14.15.4 17a,21-Dihydroxypreg-nenolone + Oxygen + Reduced adrenal ferredoxin → 11b,17a,21-Trihydroxypreg-nenolone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT Reaction1211 false 18-Hydroxycorticosterone + Oxygen + Reduced adrenal ferredoxin → Aldosterone + Oxidized adrenal ferredoxin + 2 Water LEFT_TO_RIGHT 193458 ChemSpider 1.14.15.4 false 1.14.15.4 Corticosterone + Oxygen + Reduced adrenal ferredoxin → 18-Hydroxycorticosterone + Oxidized adrenal ferredoxin + Water LEFT_TO_RIGHT ReactionCatalysis1002 ACTIVATION CHEBI:15377 ChEBI HMDB00067 HMDB 193441 ChemSpider CHEBI:15379 ChEBI CHEBI:15378 ChEBI SMILES [H+] 146693 ChemSpider 53-05-4 CAS 1.3.1.3 false 1.3.1.3 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al + NADP → Aldosterone + NADPH LEFT_TO_RIGHT P08686 UniProt 12444617 PubChem-compound 3a,21-Dihydroxy-5b-pregnane-11,20-dione 5886 PubChem-compound CHEBI:16581 ChEBI CHEBI:16341 ChEBI HMDB00063 HMDB 1.0 C00762 KEGG Compound 1.0 440695 PubChem-compound 145-13-1 CAS 9200676 ChemSpider ReactionCatalysis1017 ACTIVATION Corticosterone CHEBI:783 ChEBI Reaction1327 false NADP + Tetrahydrocortisol ↔ Dihydrocortisol + Hydrogen Ion + NADPH REVERSIBLE Reaction1207 false 11b,21-Dihydroxy-3,20-oxo-5b-pregnan-18-al + NADPH → 3a,11b,21-Trihydroxy-20-oxo-5b-pregnan-18-al + NADP LEFT_TO_RIGHT ReactionCatalysis1010 ACTIVATION 387-79-1 CAS 1.3.1.3 false 1.3.1.3 Dihydrocortisol + NADP ↔ Cortisol + Hydrogen Ion + NADPH REVERSIBLE 1.3.1.3 false 1.3.1.3 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione + NADP ↔ Cortisone + Hydrogen Ion + NADPH REVERSIBLE Reaction1324 false NADP + Tetrahydrocortisone ↔ 17a,21-Dihydroxy-5b-pregnane-3,11,20-trione + Hydrogen Ion + NADPH REVERSIBLE CHEBI:27584 ChEBI ReactionCatalysis1014 ACTIVATION ReactionCatalysis1013 ACTIVATION HMDB01487 HMDB 1.0 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase type 2 HMDB00037 HMDB Cortexolone 164838 PubChem-compound 389583 ChemSpider 389586 ChemSpider C00410 KEGG Compound 1.0 Corticosterone 641-77-0 CAS 1.1.1.146 false 1.1.1.146 NADP + Tetrahydrocorticosterone → 3a,21-Dihydroxy-5b-pregnane-11,20-dione + Hydrogen Ion + NADPH LEFT_TO_RIGHT Reaction1236 false 3a,21-Dihydroxy-5b-pregnane-11,20-dione + NADP → 21-Hydroxy-5b-pregnane-3,11,20-trione + Hydrogen Ion + NADPH LEFT_TO_RIGHT Reaction1234 true 11-Dehydrocorticosterone → 21-Hydroxy-5b-pregnane-3,11,20-trione LEFT_TO_RIGHT NADP HMDB01377 HMDB CHEBI:1307929 ChEBI 1482-50-4 CAS SMILES [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C SMILES C[C@]12C[C@H](O)C3C(CCC4C[C@H](O)CC[C@]34C)C1CC[C@]2(O)C(=O)CO 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase type 1 ReactionCatalysis1038 ACTIVATION 1.1.1.- false 1.1.1.- Corticosterone + NADP → 11-Dehydrocorticosterone + NADPH LEFT_TO_RIGHT Pregnenolone ReactionCatalysis1039 ACTIVATION 1.0 8038941 ChemSpider ReactionCatalysis2244 ACTIVATION ReactionCatalysis2243 ACTIVATION ReactionCatalysis2245 ACTIVATION