Loading Pathway...
C6H16O16P4 alpha-D-Ribose 1-methylphosphonate 5-triphosphate 467.93887 C6H14O10P2 alpha-D-Ribose 1-methylphosphonate 5-phosphate 308.00623 C5H10O10P2 alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate 291.9749 5-phospho-α-D-ribosyl 1,2-cyclic phosphate phosphodiesterase 937 ChemSpider CHEBI:68819 ChEBI PhnG subunit of methylphosphonate degradation complex PhnI subunit of methylphosphonate degradation complex RPnTP hydrolase carbon-phosphorous lyase Water 1.0 HMDB0002714 HMDB SMILES O Pyrophosphate HMDB0000250 HMDB 1.0 SMILES [O-]P([O-])(=O)OP([O-])([O-])=O 14000-31-8 CAS CHEBI:68820 ChEBI CH5O3P Methylphosphonate 95.99763 PhnL subunit of methylphosphonate degradation complex HMDB0000538 HMDB 1.0 ATP BioCyc 1.0 PhnH subunit of methylphosphonate degradation complex 1.0 559142 ChemSpider CHEBI:15422 ChEBI P16679 UniProt PW002065 PathWhiz Escherichia coli 5742 ChemSpider HMDB0011688 HMDB 1038 PubChem-compound 7732-18-5 CAS HMDB0000034 HMDB 1.0 14689-84-0 CAS C01151 KEGG Compound CH4 BioCyc Methylphosphonate Degradation I CHEBI:68689 ChEBI C01438 KEGG Compound CHEBI:68824 ChEBI ReactionCatalysis6000 ACTIVATION C10H16N5O13P3 Adenosine triphosphate 506.99576 P16689 UniProt 1010 ChemSpider 14035695 PubChem-compound P16686 UniProt Adenine P16685 UniProt P16688 UniProt P16687 UniProt PPI BioCyc C5H5N5 Adenine 135.05449 ReactionCatalysis6003 ACTIVATION ReactionCatalysis6002 ACTIVATION 2.7.8.37 false 2.7.8.37 Adenosine triphosphate + Methylphosphonate → Adenine + alpha-D-Ribose 1-methylphosphonate 5-triphosphate LEFT_TO_RIGHT ReactionCatalysis6001 ACTIVATION 3.6.1.63 false 3.6.1.63 Water + alpha-D-Ribose 1-methylphosphonate 5-triphosphate → Hydrogen Ion + Pyrophosphate + alpha-D-Ribose 1-methylphosphonate 5-phosphate LEFT_TO_RIGHT 4.7.1.1 false 4.7.1.1 alpha-D-Ribose 1-methylphosphonate 5-phosphate → Methane + alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate LEFT_TO_RIGHT 3.1.4.55 false 3.1.4.55 Water + alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate → Hydrogen Ion + Ribose 1,5-bisphosphate LEFT_TO_RIGHT 962 PubChem-compound Hydrogen Ion 26328792 ChemSpider Adenosine triphosphate C00080 KEGG Compound P16692 UniProt 1.0 HMDB0002111 HMDB 291 ChemSpider C5H12O11P2 Ribose 1,5-bisphosphate 309.98547 PhnL subunit of methylphosphonate degradation complex CHEBI:15377 ChEBI 5-phospho-α-D-ribosyl 1,2-cyclic phosphate phosphodiesterase carbon-phosphorous lyase CHEBI:15378 ChEBI SMILES [H+] PhnG subunit of methylphosphonate degradation complex PhnH subunit of methylphosphonate degradation complex ADENINE BioCyc RPnTP hydrolase PhnI subunit of methylphosphonate degradation complex C00001 KEGG Compound CHEBI:16183 ChEBI SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 CH4 Methane 16.0313 CHEBI:18361 ChEBI C00002 KEGG Compound 1.0 SMILES NC1=C2NC=NC2=NC=N1 SMP0002077 SMPDB SMILES O[C@@H]1[C@@H](COP(O)(O)=O)O[C@@H]2OP(O)(=O)O[C@H]12 644102 PubChem-compound SMILES CP(O)(=O)O[C@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O Methylphosphonate SMILES CP(O)(=O)O[C@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 74-82-8 CAS 1.0 C00013 KEGG Compound Methane O7P2 Pyrophosphate 173.91193 13818 PubChem-compound H2O Water 18.010565 Ribose 1,5-bisphosphate methylphosphonate degradation complex 5957 PubChem-compound 190 PubChem-compound SMILES O[C@H]1[C@@H](O)[C@@H](OP(O)(O)=O)O[C@@H]1COP(O)(O)=O CHEBI:16708 ChEBI 562 TAXONOMY alpha-D-Ribose 1-methylphosphonate 5-phosphate alpha-D-Ribose 1-methylphosphonate 5-triphosphate H Hydrogen Ion 1.007825 CHEBI:45129 ChEBI 1.0 alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate SMILES CP(O)(O)=O CPD-444 BioCyc HMDB0059597 HMDB 56-65-5 CAS SMILES C C00147 KEGG Compound 297 PubChem-compound 185 ChemSpider 73-24-5 CAS PhnL subunit of methylphosphonate degradation complex PhnH subunit of methylphosphonate degradation complex PhnG subunit of methylphosphonate degradation complex PhnI subunit of methylphosphonate degradation complex RPnTP hydrolase carbon- phosphorous lyase 5-phospho-α- D-ribosyl 1,2-cyclic phosphate phosphodiesterase Methylphosphonate ATP Adenine alpha-D-Ribose 1- methylphosphonate 5-triphosphate H 2 O H + PP i alpha-D-Ribose 1- methylphosphonate 5-phosphate Methane alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate H 2 O H + Ribose 1,5- bisphosphate
C6H16O16P4 alpha-D-Ribose 1-methylphosphonate 5-triphosphate 467.93887 C6H14O10P2 alpha-D-Ribose 1-methylphosphonate 5-phosphate 308.00623 C5H10O10P2 alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate 291.9749 5-phospho-α-D-ribosyl 1,2-cyclic phosphate phosphodiesterase 937 ChemSpider CHEBI:68819 ChEBI PhnG subunit of methylphosphonate degradation complex PhnI subunit of methylphosphonate degradation complex RPnTP hydrolase carbon-phosphorous lyase Water 1.0 HMDB0002714 HMDB SMILES O Pyrophosphate HMDB0000250 HMDB 1.0 SMILES [O-]P([O-])(=O)OP([O-])([O-])=O 14000-31-8 CAS CHEBI:68820 ChEBI CH5O3P Methylphosphonate 95.99763 PhnL subunit of methylphosphonate degradation complex HMDB0000538 HMDB 1.0 ATP BioCyc 1.0 PhnH subunit of methylphosphonate degradation complex 1.0 559142 ChemSpider CHEBI:15422 ChEBI P16679 UniProt PW002065 PathWhiz Escherichia coli 5742 ChemSpider HMDB0011688 HMDB 1038 PubChem-compound 7732-18-5 CAS HMDB0000034 HMDB 1.0 14689-84-0 CAS C01151 KEGG Compound CH4 BioCyc Methylphosphonate Degradation I CHEBI:68689 ChEBI C01438 KEGG Compound CHEBI:68824 ChEBI ReactionCatalysis6000 ACTIVATION C10H16N5O13P3 Adenosine triphosphate 506.99576 P16689 UniProt 1010 ChemSpider 14035695 PubChem-compound P16686 UniProt Adenine P16685 UniProt P16688 UniProt P16687 UniProt PPI BioCyc C5H5N5 Adenine 135.05449 ReactionCatalysis6003 ACTIVATION ReactionCatalysis6002 ACTIVATION 2.7.8.37 false 2.7.8.37 Adenosine triphosphate + Methylphosphonate → Adenine + alpha-D-Ribose 1-methylphosphonate 5-triphosphate LEFT_TO_RIGHT ReactionCatalysis6001 ACTIVATION 3.6.1.63 false 3.6.1.63 Water + alpha-D-Ribose 1-methylphosphonate 5-triphosphate → Hydrogen Ion + Pyrophosphate + alpha-D-Ribose 1-methylphosphonate 5-phosphate LEFT_TO_RIGHT 4.7.1.1 false 4.7.1.1 alpha-D-Ribose 1-methylphosphonate 5-phosphate → Methane + alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate LEFT_TO_RIGHT 3.1.4.55 false 3.1.4.55 Water + alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate → Hydrogen Ion + Ribose 1,5-bisphosphate LEFT_TO_RIGHT 962 PubChem-compound Hydrogen Ion 26328792 ChemSpider Adenosine triphosphate C00080 KEGG Compound P16692 UniProt 1.0 HMDB0002111 HMDB 291 ChemSpider C5H12O11P2 Ribose 1,5-bisphosphate 309.98547 PhnL subunit of methylphosphonate degradation complex CHEBI:15377 ChEBI 5-phospho-α-D-ribosyl 1,2-cyclic phosphate phosphodiesterase carbon-phosphorous lyase CHEBI:15378 ChEBI SMILES [H+] PhnG subunit of methylphosphonate degradation complex PhnH subunit of methylphosphonate degradation complex ADENINE BioCyc RPnTP hydrolase PhnI subunit of methylphosphonate degradation complex C00001 KEGG Compound CHEBI:16183 ChEBI SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 CH4 Methane 16.0313 CHEBI:18361 ChEBI C00002 KEGG Compound 1.0 SMILES NC1=C2NC=NC2=NC=N1 SMP0002077 SMPDB SMILES O[C@@H]1[C@@H](COP(O)(O)=O)O[C@@H]2OP(O)(=O)O[C@H]12 644102 PubChem-compound SMILES CP(O)(=O)O[C@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O Methylphosphonate SMILES CP(O)(=O)O[C@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 74-82-8 CAS 1.0 C00013 KEGG Compound Methane O7P2 Pyrophosphate 173.91193 13818 PubChem-compound H2O Water 18.010565 Ribose 1,5-bisphosphate methylphosphonate degradation complex 5957 PubChem-compound 190 PubChem-compound SMILES O[C@H]1[C@@H](O)[C@@H](OP(O)(O)=O)O[C@@H]1COP(O)(O)=O CHEBI:16708 ChEBI 562 TAXONOMY alpha-D-Ribose 1-methylphosphonate 5-phosphate alpha-D-Ribose 1-methylphosphonate 5-triphosphate H Hydrogen Ion 1.007825 CHEBI:45129 ChEBI 1.0 alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate SMILES CP(O)(O)=O CPD-444 BioCyc HMDB0059597 HMDB 56-65-5 CAS SMILES C C00147 KEGG Compound 297 PubChem-compound 185 ChemSpider 73-24-5 CAS phnL phnH phnG phnI phnM phnJ phnP Methylphosphonate Adenosine triphosphate Adenine alpha-D-Ribose 1- methylphosphonate 5-triphosphate Water Hydrogen Ion Pyrophosphate alpha-D-Ribose 1- methylphosphonate 5-phosphate Methane alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate Water Hydrogen Ion Ribose 1,5- bisphosphate