Loading Pathway...
CHEBI:16015 ChEBI 30572 ChemSpider 17215925 ChemSpider 6022 PubChem-compound 937 ChemSpider C00311 KEGG Compound CHEBI:16134 ChEBI NADH 439153 PubChem-compound 1.0 SMILES O H3N Ammonia 17.026548 50 ChemSpider 1.0 HMDB0000538 HMDB NAD ATP BioCyc 5961 PubChem-compound 1.0 1.0 51 PubChem-compound CHEBI:15846 ChEBI ADP BioCyc 1.0 Glutamine synthetase 53-59-8 CAS Isocitrate dehydrogenase [NADP], mitochondrial Isocitrate dehydrogenase [NADP] cytoplasmic 5746 ChemSpider 1.0 C6H8O7 Isocitric acid 192.02701 Isocitrate dehydrogenase [NADP] 5742 ChemSpider 1038 PubChem-compound CHEBI:16474 ChEBI Ammonia 274 ChemSpider C5H6O5 Oxoglutaric acid 146.02153 CHEBI:16908 ChEBI P39708 UniProt O4P Phosphate 94.95342 NADPH 1010 ChemSpider Saccharomyces cerevisiae 2.0 NADP CHEBI:30887 ChEBI C21H30N7O17P3 NADPH 745.0911 C21H29N7O17P3 NADP 744.08325 1.0 NADPH BioCyc ReactionCatalysis7060 ACTIVATION Hydrogen Ion C5H10N2O3 L-Glutamine 146.06914 HMDB0000208 HMDB 1161 ChemSpider 217 ChemSpider Adenosine triphosphate 58-68-4 CAS L-Glutamic acid SMILES [O-]P([O-])([O-])=O HMDB0000217 HMDB SMILES OC(=O)CCC(=O)C(O)=O 124-38-9 CAS CHEBI:30915 ChEBI C00009 KEGG Compound C00008 KEGG Compound C00006 KEGG Compound 1.0 CHEBI:18009 ChEBI HMDB0001429 HMDB C00001 KEGG Compound C00005 KEGG Compound CHEBI:18367 ChEBI C00004 KEGG Compound 1032 ChemSpider C00003 KEGG Compound C00002 KEGG Compound SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O HMDB0000221 HMDB SMILES NC(=O)C1=CN(C=CC1)[C@H]1O[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](OP(O)(O)=O)[C@H]2O)N2C=NC3=C(N)N=CN=C23)[C@H](O)[C@@H]1O GLN BioCyc 7664-41-7 CAS GLT BioCyc 53-57-6 CAS P53982 UniProt P32288 UniProt C21H28N7O14P2 NAD 664.11694 C00011 KEGG Compound SMILES O=C=O HMDB0000902 HMDB 222 PubChem-compound C00014 KEGG Compound P21954 UniProt NAD(P) BioCyc C21H29N7O14P2 NADH 665.12476 5957 PubChem-compound 320-77-4 CAS H Hydrogen Ion 1.007825 threo-d(s)-iso-citrate BioCyc L-Glutamine 56-65-5 CAS 53-84-9 CAS C00026 KEGG Compound C00025 KEGG Compound Adenosine diphosphate SMILES OC(C(CC(O)=O)C(O)=O)C(O)=O C10H15N5O10P2 Adenosine diphosphate 427.02942 1.0 1.4.1.4 false 1.4.1.4 Ammonia + Hydrogen Ion + NADPH + Oxoglutaric acid → L-Glutamic acid + NADP + Water LEFT_TO_RIGHT 1.4.1.4 false 1.4.1.4 Ammonia + Hydrogen Ion + NADPH + Oxoglutaric acid → L-Glutamic acid + NADP + Water LEFT_TO_RIGHT 1.0 P07262 UniProt CPD-8587 BioCyc SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=CN=C3N)[C@@H](O)[C@H]1O 5682 ChemSpider 328-50-7 CAS SMILES NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O Water 6.3.1.2 false 6.3.1.2 Adenosine triphosphate + Ammonia + L-Glutamic acid → Adenosine diphosphate + L-Glutamine + Phosphate LEFT_TO_RIGHT 1.1.1.42 false 1.1.1.42 Isocitric acid + NADP → Carbon dioxide + Hydrogen Ion + NADPH + Oxoglutaric acid LEFT_TO_RIGHT 1.4.1.14 false 1.4.1.14 L-Glutamine + NADH + Oxoglutaric acid → 2 L-Glutamic acid + NAD LEFT_TO_RIGHT HMDB0001341 HMDB NADP-dependent glutamate dehydrogenase 2 1.1.1.42 false 1.1.1.42 Isocitric acid + NADP → Carbon dioxide + Hydrogen Ion + NADPH + Oxoglutaric acid LEFT_TO_RIGHT 1.1.1.42 false 1.1.1.42 Isocitric acid + NADP → Carbon dioxide + Hydrogen Ion + NADPH + Oxoglutaric acid LEFT_TO_RIGHT glutamate synthase 5675 ChemSpider NADP-dependent glutamate dehydrogenase 56-85-9 CAS SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O HMDB0000148 HMDB PW002504 PathWhiz CHEBI:15422 ChEBI Q12680 UniProt 388299 ChemSpider 7732-18-5 CAS HMDB0001487 HMDB 1.0 AMMONIA BioCyc SMILES N 56-86-0 CAS C5H9NO4 L-Glutamic acid 147.05316 33032 PubChem-compound ReactionCatalysis7056 ACTIVATION C10H16N5O13P3 Adenosine triphosphate 506.99576 ReactionCatalysis7055 ACTIVATION ReactionCatalysis7054 ACTIVATION CHEBI:16526 ChEBI C00064 KEGG Compound 1.0 1.0 CHEBI:16761 ChEBI Nitrogen Metabolism Glutamine synthetase Isocitrate dehydrogenase [NADP] ReactionCatalysis7059 ACTIVATION ReactionCatalysis7058 ACTIVATION ReactionCatalysis7057 ACTIVATION Isocitrate dehydrogenase [NADP] cytoplasmic Isocitrate dehydrogenase [NADP], mitochondrial 962 PubChem-compound P41939 UniProt glutamate synthase 2-KETOGLUTARATE BioCyc 5800 ChemSpider CO2 Carbon dioxide 43.98983 Phosphate 1.0 5893 PubChem-compound C00080 KEGG Compound Oxoglutaric acid HMDB0000051 HMDB SMILES N[C@@H](CCC(O)=O)C(O)=O HMDB0002111 HMDB NADP-dependent glutamate dehydrogenase 2 NADP-dependent glutamate dehydrogenase CHEBI:15377 ChEBI CHEBI:15378 ChEBI SMILES [H+] 14265-44-2 CAS 58-64-0 CAS SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 5886 PubChem-compound Isocitric acid 1.0 280 PubChem-compound 4932 TAXONOMY SMP0002403 SMPDB SMILES N[C@@H](CCC(N)=O)C(O)=O 1198 PubChem-compound 22833512 PubChem-compound CHEBI:18050 ChEBI H2O Water 18.010565 HMDB0000193 HMDB NADH BioCyc NAD BioCyc 1061 PubChem-compound HMDB0059597 HMDB Carbon dioxide HMDB0001967 HMDB HMDB0000641 HMDB Isocitrate dehydrogenase [NADP], mitochondrial Isocitrate dehydrogenase [NADP] cytoplasmic Isocitrate dehydrogenase 3, CYTOPLASM,PEROXISOME Glutamine synthetase glutamate synthase NADP-dependent glutamate dehydrogenase NADP-dependent glutamate dehydrogenase 2 NADP Isocitric acid CO 2 H + NADPH Oxoglutaric acid Isocitric acid NADP CO 2 H + NADPH Oxoglutaric acid Isocitric acid NADP CO 2 H + NADPH Oxoglutaric acid NH 3 L-Glutamic acid ATP L-Glutamine ADP P i Oxoglutaric acid NADH NAD L-Glutamic acid NH 3 Oxoglutaric acid H + NADPH H 2 O NADP NH 3 NADPH H + Oxoglutaric acid H 2 O NADP
CHEBI:16015 ChEBI 30572 ChemSpider 17215925 ChemSpider 6022 PubChem-compound 937 ChemSpider C00311 KEGG Compound CHEBI:16134 ChEBI NADH 439153 PubChem-compound 1.0 SMILES O H3N Ammonia 17.026548 50 ChemSpider 1.0 HMDB0000538 HMDB NAD ATP BioCyc 5961 PubChem-compound 1.0 1.0 51 PubChem-compound CHEBI:15846 ChEBI ADP BioCyc 1.0 Glutamine synthetase 53-59-8 CAS Isocitrate dehydrogenase [NADP], mitochondrial Isocitrate dehydrogenase [NADP] cytoplasmic 5746 ChemSpider 1.0 C6H8O7 Isocitric acid 192.02701 Isocitrate dehydrogenase [NADP] 5742 ChemSpider 1038 PubChem-compound CHEBI:16474 ChEBI Ammonia 274 ChemSpider C5H6O5 Oxoglutaric acid 146.02153 CHEBI:16908 ChEBI P39708 UniProt O4P Phosphate 94.95342 NADPH 1010 ChemSpider Saccharomyces cerevisiae 2.0 NADP CHEBI:30887 ChEBI C21H30N7O17P3 NADPH 745.0911 C21H29N7O17P3 NADP 744.08325 1.0 NADPH BioCyc ReactionCatalysis7060 ACTIVATION Hydrogen Ion C5H10N2O3 L-Glutamine 146.06914 HMDB0000208 HMDB 1161 ChemSpider 217 ChemSpider Adenosine triphosphate 58-68-4 CAS L-Glutamic acid SMILES [O-]P([O-])([O-])=O HMDB0000217 HMDB SMILES OC(=O)CCC(=O)C(O)=O 124-38-9 CAS CHEBI:30915 ChEBI C00009 KEGG Compound C00008 KEGG Compound C00006 KEGG Compound 1.0 CHEBI:18009 ChEBI HMDB0001429 HMDB C00001 KEGG Compound C00005 KEGG Compound CHEBI:18367 ChEBI C00004 KEGG Compound 1032 ChemSpider C00003 KEGG Compound C00002 KEGG Compound SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O HMDB0000221 HMDB SMILES NC(=O)C1=CN(C=CC1)[C@H]1O[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2O[C@@H]([C@@H](OP(O)(O)=O)[C@H]2O)N2C=NC3=C(N)N=CN=C23)[C@H](O)[C@@H]1O GLN BioCyc 7664-41-7 CAS GLT BioCyc 53-57-6 CAS P53982 UniProt P32288 UniProt C21H28N7O14P2 NAD 664.11694 C00011 KEGG Compound SMILES O=C=O HMDB0000902 HMDB 222 PubChem-compound C00014 KEGG Compound P21954 UniProt NAD(P) BioCyc C21H29N7O14P2 NADH 665.12476 5957 PubChem-compound 320-77-4 CAS H Hydrogen Ion 1.007825 threo-d(s)-iso-citrate BioCyc L-Glutamine 56-65-5 CAS 53-84-9 CAS C00026 KEGG Compound C00025 KEGG Compound Adenosine diphosphate SMILES OC(C(CC(O)=O)C(O)=O)C(O)=O C10H15N5O10P2 Adenosine diphosphate 427.02942 1.0 1.4.1.4 false 1.4.1.4 Ammonia + Hydrogen Ion + NADPH + Oxoglutaric acid → L-Glutamic acid + NADP + Water LEFT_TO_RIGHT 1.4.1.4 false 1.4.1.4 Ammonia + Hydrogen Ion + NADPH + Oxoglutaric acid → L-Glutamic acid + NADP + Water LEFT_TO_RIGHT 1.0 P07262 UniProt CPD-8587 BioCyc SMILES NC(=O)C1=C[N+](=CC=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=CN=C3N)[C@@H](O)[C@H]1O 5682 ChemSpider 328-50-7 CAS SMILES NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O Water 6.3.1.2 false 6.3.1.2 Adenosine triphosphate + Ammonia + L-Glutamic acid → Adenosine diphosphate + L-Glutamine + Phosphate LEFT_TO_RIGHT 1.1.1.42 false 1.1.1.42 Isocitric acid + NADP → Carbon dioxide + Hydrogen Ion + NADPH + Oxoglutaric acid LEFT_TO_RIGHT 1.4.1.14 false 1.4.1.14 L-Glutamine + NADH + Oxoglutaric acid → 2 L-Glutamic acid + NAD LEFT_TO_RIGHT HMDB0001341 HMDB NADP-dependent glutamate dehydrogenase 2 1.1.1.42 false 1.1.1.42 Isocitric acid + NADP → Carbon dioxide + Hydrogen Ion + NADPH + Oxoglutaric acid LEFT_TO_RIGHT 1.1.1.42 false 1.1.1.42 Isocitric acid + NADP → Carbon dioxide + Hydrogen Ion + NADPH + Oxoglutaric acid LEFT_TO_RIGHT glutamate synthase 5675 ChemSpider NADP-dependent glutamate dehydrogenase 56-85-9 CAS SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O HMDB0000148 HMDB PW002504 PathWhiz CHEBI:15422 ChEBI Q12680 UniProt 388299 ChemSpider 7732-18-5 CAS HMDB0001487 HMDB 1.0 AMMONIA BioCyc SMILES N 56-86-0 CAS C5H9NO4 L-Glutamic acid 147.05316 33032 PubChem-compound ReactionCatalysis7056 ACTIVATION C10H16N5O13P3 Adenosine triphosphate 506.99576 ReactionCatalysis7055 ACTIVATION ReactionCatalysis7054 ACTIVATION CHEBI:16526 ChEBI C00064 KEGG Compound 1.0 1.0 CHEBI:16761 ChEBI Nitrogen Metabolism Glutamine synthetase Isocitrate dehydrogenase [NADP] ReactionCatalysis7059 ACTIVATION ReactionCatalysis7058 ACTIVATION ReactionCatalysis7057 ACTIVATION Isocitrate dehydrogenase [NADP] cytoplasmic Isocitrate dehydrogenase [NADP], mitochondrial 962 PubChem-compound P41939 UniProt glutamate synthase 2-KETOGLUTARATE BioCyc 5800 ChemSpider CO2 Carbon dioxide 43.98983 Phosphate 1.0 5893 PubChem-compound C00080 KEGG Compound Oxoglutaric acid HMDB0000051 HMDB SMILES N[C@@H](CCC(O)=O)C(O)=O HMDB0002111 HMDB NADP-dependent glutamate dehydrogenase 2 NADP-dependent glutamate dehydrogenase CHEBI:15377 ChEBI CHEBI:15378 ChEBI SMILES [H+] 14265-44-2 CAS 58-64-0 CAS SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 5886 PubChem-compound Isocitric acid 1.0 280 PubChem-compound 4932 TAXONOMY SMP0002403 SMPDB SMILES N[C@@H](CCC(N)=O)C(O)=O 1198 PubChem-compound 22833512 PubChem-compound CHEBI:18050 ChEBI H2O Water 18.010565 HMDB0000193 HMDB NADH BioCyc NAD BioCyc 1061 PubChem-compound HMDB0059597 HMDB Carbon dioxide HMDB0001967 HMDB HMDB0000641 HMDB Mitochondria Peroxisome IDP1 IDP2 IDP3 GLN1 GLT1 GDH1 GDH3 NADP Isocitric acid Carbon dioxide Hydrogen Ion NADPH Oxoglutaric acid Isocitric acid NADP Carbon dioxide Hydrogen Ion NADPH Oxoglutaric acid Isocitric acid NADP Carbon dioxide Hydrogen Ion NADPH Oxoglutaric acid Ammonia L-Glutamic acid Adenosine triphosphate L-Glutamine Adenosine diphosphate Phosphate Oxoglutaric acid NADH NAD L-Glutamic acid Ammonia Oxoglutaric acid Hydrogen Ion NADPH Water NADP Ammonia NADPH Hydrogen Ion Oxoglutaric acid Water NADP