Loading Pathway...
chebulagic acid Metabolism 9606 TAXONOMY C8H11NO 2-(2-methylpyridin-3-yl)ethanol 137.08406 2-(2-methylpyridin-3-yl)ethanol CHEBI:58483 ChEBI 268518 PubChem-compound Homo sapiens SMILES [H][C@@]1(O)COP([O-])(=O)OP([O-])(=O)O[C@@]1(C)CO 1.0 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate C5H10O9P2 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate 275.98 SMILES CC=C(N)C([O-])=O C4H6NO2 (2Z)-2-aminobut-2-enoate 100.040405 PW064753 PathWhiz Reaction164287 false (2Z)-2-aminobut-2-enoate + 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate ? 2-(2-methylpyridin-3-yl)ethanol (2Z)-2-aminobut-2-enoate 1.0 CHEBI:58739 ChEBI SMILES CC1=C(CCO)C=CC=N1 1.0 SMP0063763 SMPDB 5'-nucleotidase 5'-nucleotidase (2Z)-2- aminobut-2- enoate 2-C-Methyl-D- erythritol- 2,4- cyclodiphosphate 2-(2- methylpyridin- 3-yl)ethanol 1- Methylhistidine