Loading Pathway...
CHEBI:16015 ChEBI C5H11NO2 L-Valine 117.07898 6022 PubChem-compound 6140 PubChem-compound 1.0 CYS BioCyc 1.0 HMDB00250 HMDB 6267 PubChem-compound HMDB01341 HMDB 63-91-2 CAS 946416 INSDC 1.0 73-32-5 CAS 1.0 CHEBI:16027 ChEBI CHEBI:17115 ChEBI HMDB00148 HMDB 945331 INSDC 5833 ChemSpider Glycyl-tRNA synthetase alpha subunit Glycyl-tRNA synthetase beta subunit Alanyl-tRNA synthetase ATP BioCyc Methionyl-tRNA synthetase 6137 PubChem-compound Glutaminyl-tRNA synthetase 1.0 Tryptophanyl-tRNA synthetase Isoleucyl-tRNA synthetase 559142 ChemSpider PRO BioCyc 1.0 945336 INSDC 6287 PubChem-compound 6288 PubChem-compound 5747 ChemSpider CHEBI:17203 ChEBI 5746 ChemSpider 1.0 5745 ChemSpider 5742 ChemSpider ASN BioCyc L-ASPARTATE BioCyc 1.0 CHEBI:17561 ChEBI HMDB59597 HMDB TYR BioCyc ARG BioCyc 5858 ChemSpider 1.0 HMDB00123 HMDB 5736 ChemSpider 6274 PubChem-compound L-Valine 1.0 5735 ChemSpider 1.0 1.0 1.0 Prolyl-tRNA synthetase 1010 ChemSpider 73-22-3 CAS Glutamyl-tRNA synthetase PPI BioCyc 1.0 1.0 HMDB00574 HMDB HMDB00696 HMDB Hydrogen Ion C5H10N2O3 L-Glutamine 146.06914 1.0 C11H12N2O2 L-Tryptophan 204.08987 6106 PubChem-compound Adenosine triphosphate 5880 ChemSpider 1.0 1.0 56-87-1 CAS C00008 KEGG Compound 1.0 1.0 L-ALPHA-ALANINE BioCyc LEU BioCyc CHEBI:18361 ChEBI 56-41-7 CAS CHEBI:18366 ChEBI C00002 KEGG Compound C00123 KEGG Compound 945257 INSDC 1.0 1.0 945264 INSDC 44367445 PubChem-compound C00135 KEGG Compound C00013 KEGG Compound Threonine/serine transporter tdcC 1.0 1.0 947202 INSDC H Hydrogen Ion 1.007825 HMDB00687 HMDB L-Glutamine 56-65-5 CAS L-Tryptophan MET BioCyc C00020 KEGG Compound 5653 ChemSpider C00148 KEGG Compound 2.0 C00025 KEGG Compound Cysteinyl-tRNA synthetase Aspartyl-tRNA synthetase 1.0 C5H11NO2S L-Methionine 149.05106 CHEBI:29170 ChEBI methionine biosynthesis SubPathway CHEBI:29172 ChEBI isoleucine biosynthesis SubPathway CHEBI:29171 ChEBI threonine biosynthesis SubPathway SubPathwayInteraction1169 SubPathway1169Reaction SubPathwayReaction 52-90-4 CAS P16659 UniProt C00152 KEGG Compound SubPathwayInteraction1165 SubPathway1165Reaction SubPathwayReaction C00037 KEGG Compound SubPathwayInteraction1164 SubPathwayReaction SubPathway1164Reaction SubPathwayInteraction1166 SubPathway1166Reaction SubPathwayReaction SubPathwayInteraction1172 SubPathway1172Reaction SubPathwayReaction SubPathwayInteraction1171 SubPathway1171Reaction SubPathwayReaction AMP BioCyc Tyrosyl-tRNA synthetase C00041 KEGG Compound 1.0 L-prolyl-tRNA(Pro) SubPathwayInteraction1170 SubPathwayReaction SubPathway1170Reaction L-arginyl-tRNA(Arg) CHEBI:29173 ChEBI tRNA(Pro) tRNA(Cys) tRNA(Arg) CHEBI:29175 ChEBI CHEBI:29178 ChEBI L-methionyl-tRNA(Met) L-cysteinyl-tRNA(Cys) CHEBI:29177 ChEBI SMILES [O-]P([O-])(=O)OP([O-])([O-])=O tRNA(Phe) CHEBI:29161 ChEBI CHEBI:17196 ChEBI 128566 ChemSpider C00049 KEGG Compound L-Cysteine C00047 KEGG Compound 56-85-9 CAS SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 L-phenylalanyl-tRNA(Phe) Histidyl-tRNA synthetase L-tyrosyl-tRNA(Tyr) CHEBI:17191 ChEBI tRNA(Tyr) L-histidyl-tRNA(His) HMDB00538 HMDB CHEBI:29162 ChEBI 944884 INSDC tRNA(His) SMP00794 SMPDB L-Seryl-tRNA(Ser) L-tryptophyl-tRNA(Trp) CHEBI:29167 ChEBI TRP BioCyc Glycyl-tRNA(Gly) 1.0 CHEBI:18019 ChEBI Arginyl-tRNA synthetase SMILES N[C@@H](CCCNC(N)=N)C(O)=O 61-19-8 CAS 72-18-4 CAS SMILES NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 CHEBI:29159 ChEBI 1.0 C00062 KEGG Compound C00183 KEGG Compound 56-86-0 CAS CHEBI:29152 ChEBI 63-68-3 CAS CHEBI:29154 ChEBI CHEBI:29153 ChEBI CHEBI:29156 ChEBI CHEBI:29155 ChEBI CHEBI:29158 ChEBI CHEBI:29157 ChEBI 945501 INSDC 5907 ChemSpider HMDB00883 HMDB HMDB00641 HMDB C10H16N5O13P3 Adenosine triphosphate 506.99576 1.0 C00188 KEGG Compound CHEBI:17053 ChEBI CHEBI:17295 ChEBI 56-40-6 CAS C00065 KEGG Compound C00064 KEGG Compound L-Methionine Asparaginyl-tRNA synthetase Seryl-tRNA synthetase L-Leucine C00073 KEGG Compound HMDB00517 HMDB C6H13NO2 L-Leucine 131.09464 PHE BioCyc CHEBI:29265 ChEBI C4H9NO3 L-Threonine 119.05824 C5H9NO2 L-Proline 115.06333 C3H7NO2 L-Alanine 89.047676 C9H11NO2 L-Phenylalanine 165.07898 5800 ChemSpider C9H11NO3 L-Tyrosine 181.0739 C00078 KEGG Compound 145742 PubChem-compound C00079 KEGG Compound Lysyl-tRNA synthetase, heat inducible C00080 KEGG Compound 730 ChemSpider PW000818 PathWhiz 1.0 1.0 C00082 KEGG Compound PW000813 PathWhiz C6H13NO2 L-Isoleucine 131.09464 PW000812 PathWhiz PW000811 PathWhiz C4H8N2O3 L-Asparagine 132.0535 PW000810 PathWhiz SMILES N[C@@H](CCC(O)=O)C(O)=O PW000817 PathWhiz tRNA Charging 2 PW000815 PathWhiz PW000814 PathWhiz 6057 PubChem-compound C6H14N2O2 L-Lysine 146.10553 C6H9N3O2 L-Histidine 155.06947 5910 ChemSpider 58-64-0 CAS 1.0 PW000809 PathWhiz PW000808 PathWhiz PW000807 PathWhiz L-Aspartic acid L-Serine C4H7NO4 L-Aspartic acid 133.0375 PW000800 PathWhiz C3H7NO3 L-Serine 105.042595 PW000806 PathWhiz 1.0 PW000803 PathWhiz cysteine biosynthesis SubPathway arginine metabolism SubPathway L-alanine metabolism SubPathway 644102 PubChem-compound C3H7NO2S L-Cysteine 121.01975 L-glutamate metabolism ActivatingSubPathway 2.0 6083 PubChem-compound L-Histidine GLYCINE BIOSYNTHESIS SubPathway C00097 KEGG Compound B1XGT1 UniProt proline metabolism SubPathway Lysine Biosynthesis SubPathway L-Lysine tyrosine biosynthesis SubPathway Aspartate metabolism SubPathway SubPathwayInteraction1152 SubPathwayReaction SubPathway1152Reaction SubPathwayInteraction1151 SubPathway1151Reaction SubPathwayReaction L-Isoleucine CHEBI:18050 ChEBI L-Asparagine Prolyl-tRNA synthetase SMILES NCC(O)=O Leucine Biosynthesis SubPathway histidine biosynthesis SubPathway L-glutamate metabolism SubPathway phenylalanine biosynthesis SubPathway Valine Biosynthesis SubPathway CHEBI:29182 ChEBI Asparagine biosynthesis SubPathway L-Alanine SubPathwayInteraction1158 SubPathway1158Reaction SubPathwayReaction 56-84-8 CAS L-Phenylalanine SubPathwayInteraction1157 SubPathway1157Reaction SubPathwayReaction L-Tyrosine 1.0 SubPathwayInteraction1159 SubPathwayReaction SubPathway1159Reaction L-Threonine SubPathwayInteraction1154 SubPathway1154Reaction SubPathwayReaction serine biosynthesis and metabolism SubPathway 1.0 SubPathwayInteraction1156 SubPathwayReaction SubPathway1156Reaction tryptophan metabolism SubPathway L-Proline SubPathwayInteraction1155 SubPathwayReaction SubPathway1155Reaction SubPathwayInteraction1161 SubPathwayReaction SubPathway1161Reaction SubPathwayInteraction1160 SubPathway1160Reaction SubPathwayReaction ReactionCatalysis2800 ACTIVATION SubPathwayInteraction1163 SubPathwayReaction SubPathway1163Reaction SubPathwayInteraction1162 SubPathwayReaction SubPathway1162Reaction ReactionCatalysis2802 ACTIVATION 70-47-3 CAS ReactionCatalysis2801 ACTIVATION ReactionCatalysis2803 ACTIVATION CHEBI:29184 ChEBI 1.0 1.0 2.0 CHEBI:29186 ChEBI 1.0 P07813 UniProt 2.0 SMP00824 SMPDB 1.0 30572 ChemSpider SMP00826 SMPDB CHEBI:15603 ChEBI SMP00821 SMPDB 948275 INSDC SMILES N[C@@H](CS)C(O)=O L-Valyl-tRNA(Val) tRNA(Val) tRNA(Ile) SMP00827 SMPDB 2.0 SMP00828 SMPDB SMP00829 SMPDB tRNA(Ser) tRNA(gly) P0AGJ9 UniProt L-Threonyl-tRNA(Thr) tRNA(Thr) L-Leucyl-tRNA(Leu) tRNA(Leu) P0A8M0 UniProt 1.0 C6H14N4O2 L-Arginine 174.11168 Pyrophosphate C10H14N5O7P Adenosine monophosphate 347.06308 HMDB00929 HMDB CHEBI:15971 ChEBI SMP00834 SMPDB SMP00835 SMPDB Phenylalanyl-tRNA synthetase beta chain SMP00837 SMPDB SMP00830 SMPDB SMP00831 SMPDB SMP00832 SMPDB Valyl-tRNA synthetase SMP00833 SMPDB L-Seryl-tRNA(Ser) Glycyl-tRNA(Gly) 5961 PubChem-compound SMP00838 SMPDB 5962 PubChem-compound 1.0 ReactionCatalysis2787 ACTIVATION ReactionCatalysis2786 ACTIVATION 1.0 ReactionCatalysis2789 ACTIVATION tRNA(Tyr) ReactionCatalysis2788 ACTIVATION L-phenylalanyl-tRNA(Phe) SMILES N[C@@H](CC1=CC=C(O)C=C1)C(O)=O tRNA(His) L-tyrosyl-tRNA(Tyr) L-tryptophyl-tRNA(Trp) L-histidyl-tRNA(His) ADP BioCyc P0A8N5 UniProt ReactionCatalysis2785 ACTIVATION ReactionCatalysis2784 ACTIVATION tRNA(Asn) L-alanyl-tRNA(Ala) tRNA(Ala) 1.0 Leucyl-tRNA synthetase THR BioCyc 6038 ChemSpider tRNA(Met) 1038 PubChem-compound tRNA(Glu) L-glutamyl-tRNA(Glu) L-aspartyl-tRNA(Asp) tRNA(Asp) L-asparaginyl-tRNA(Asn) SMILES CSCC[C@H](N)C(O)=O ReactionCatalysis2798 ACTIVATION LYS BioCyc ReactionCatalysis2797 ACTIVATION ReactionCatalysis2799 ACTIVATION L-Arginine Adenosine monophosphate ReactionCatalysis2790 ACTIVATION ReactionCatalysis2792 ACTIVATION ReactionCatalysis2791 ACTIVATION ReactionCatalysis2794 ACTIVATION ReactionCatalysis2793 ACTIVATION ReactionCatalysis2796 ACTIVATION ReactionCatalysis2795 ACTIVATION Phenylalanyl-tRNA synthetase alpha chain 1.0 2.0 5862 PubChem-compound SER BioCyc tRNA(Gln) L-Isoleucyl-tRNA(Ile) 6031 ChemSpider tRNA(Trp) L-Glutaminyl-tRNA(Gln) L-Lysyl-tRNA tRNA(Lys) GLY BioCyc Reaction2829 false Adenosine triphosphate + Hydrogen Ion + L-Threonine + tRNA(Thr) → Adenosine monophosphate + L-Threonyl-tRNA(Thr) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.14 false 6.1.1.14 Adenosine triphosphate + Glycine + Hydrogen Ion + tRNA(gly) → Adenosine monophosphate + Glycyl-tRNA(Gly) + Pyrophosphate LEFT_TO_RIGHT PW000787 PathWhiz 6.1.1.11 false 6.1.1.11 Adenosine triphosphate + Hydrogen Ion + L-Serine + tRNA(Ser) → Adenosine monophosphate + L-Seryl-tRNA(Ser) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.17 false 6.1.1.17 Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid + tRNA(Glu) → Adenosine monophosphate + L-glutamyl-tRNA(Glu) + Pyrophosphate LEFT_TO_RIGHT CHEBI:16857 ChEBI 6.1.1.7 false 6.1.1.7 Adenosine triphosphate + Hydrogen Ion + L-Alanine + tRNA(Ala) → Adenosine monophosphate + L-alanyl-tRNA(Ala) + Pyrophosphate LEFT_TO_RIGHT CHEBI:16977 ChEBI glycyl-tRNA synthetase 71-00-1 CAS 1.0 SubPathwayControl1153 ActivatingSubPathwayControl SubPathway1153Control 1.0 L-Glutamic acid 72-19-5 CAS 6.1.1.19 false 6.1.1.19 Adenosine triphosphate + Hydrogen Ion + L-Arginine + tRNA(Arg) → Adenosine monophosphate + L-arginyl-tRNA(Arg) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.16 false 6.1.1.16 Adenosine triphosphate + Hydrogen Ion + L-Cysteine + tRNA(Cys) → Adenosine monophosphate + L-cysteinyl-tRNA(Cys) + Pyrophosphate LEFT_TO_RIGHT C2H5NO2 Glycine 75.03203 alanyl-tRNA synthetase Tyrosyl-tRNA synthetase PW000771 PathWhiz 1.0 1.0 6050 ChemSpider 5257127 PubChem-compound 6051 ChemSpider seryl-tRNA synthetase GLN BioCyc GLT BioCyc P04805 UniProt 1.0 1.0 Glycyl-tRNA synthetase beta subunit Glutaminyl-tRNA synthetase Methionyl-tRNA synthetase Glycyl-tRNA synthetase alpha subunit Isoleucyl-tRNA synthetase histidyl-tRNA synthetase SMP00809 SMPDB Alanyl-tRNA synthetase SMILES OC(=O)[C@@H]1CCCN1 SMILES C[C@H](N)C(O)=O methionyl-tRNA synthetase 2.0 Tryptophanyl-tRNA synthetase SMILES N[C@@H](CC1=CC=CC=C1)C(O)=O lysine tRNA synthetase 5950 PubChem-compound 5951 PubChem-compound SMILES C[C@@H](O)[C@H](N)C(O)=O SMILES N[C@@H](CC(N)=O)C(O)=O O7P2 Pyrophosphate 173.91193 tRNA(gly) 6082 ChemSpider Glycine tRNA(Thr) SMILES CC[C@H](C)[C@H](N)C(O)=O 5957 PubChem-compound tRNA(Ser) phenylalanyl-tRNA synthetase tRNA(Leu) L-Threonyl-tRNA(Thr) tRNA(Val) CHEBI:16828 ChEBI L-Leucyl-tRNA(Leu) tRNA(Ile) 6.1.1.10 false 6.1.1.10 Adenosine triphosphate + Hydrogen Ion + L-Methionine + tRNA(Met) → Adenosine monophosphate + L-methionyl-tRNA(Met) + Pyrophosphate LEFT_TO_RIGHT L-Valyl-tRNA(Val) 6.1.1.15 false 6.1.1.15 Adenosine triphosphate + Hydrogen Ion + L-Proline + tRNA(Pro) → Adenosine monophosphate + L-prolyl-tRNA(Pro) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.6 false 6.1.1.6 Adenosine triphosphate + Hydrogen Ion + L-Lysine + tRNA(Lys) → Adenosine monophosphate + L-Lysyl-tRNA + Pyrophosphate LEFT_TO_RIGHT SMP00812 SMPDB SMP00815 SMPDB 6.1.1.22 false 6.1.1.22 Adenosine triphosphate + Hydrogen Ion + L-Asparagine + tRNA(Asn) → Adenosine monophosphate + L-asparaginyl-tRNA(Asn) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.21 false 6.1.1.21 Adenosine triphosphate + Hydrogen Ion + L-Histidine + tRNA(His) → Adenosine monophosphate + L-histidyl-tRNA(His) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.2 false 6.1.1.2 Adenosine triphosphate + Hydrogen Ion + L-Tryptophan + tRNA(Trp) → Adenosine monophosphate + L-tryptophyl-tRNA(Trp) + Pyrophosphate LEFT_TO_RIGHT SMP00810 SMPDB 6.1.1.20 false 6.1.1.20 Adenosine triphosphate + Hydrogen Ion + L-Phenylalanine + tRNA(Phe) → Adenosine monophosphate + L-phenylalanyl-tRNA(Phe) + Pyrophosphate LEFT_TO_RIGHT SMP00811 SMPDB SMILES NCCCC[C@H](N)C(O)=O SMILES N[C@@H](CC1=CN=CN1)C(O)=O 6067 ChemSpider 6066 ChemSpider SMILES N[C@@H](CO)C(O)=O Adenosine diphosphate L-Isoleucyl-tRNA(Ile) Lysyl-tRNA synthetase, heat inducible C10H15N5O10P2 Adenosine diphosphate 427.02942 L-Glutaminyl-tRNA(Gln) tRNA(Gln) prolyl-tRNA synthetase SMILES N[C@@H](CC(O)=O)C(O)=O tRNA(Lys) 1.0 tRNA(Trp) 6.1.1.12 false 6.1.1.12 Adenosine triphosphate + Hydrogen Ion + L-Aspartic acid + tRNA(Asp) → Adenosine monophosphate + L-aspartyl-tRNA(Asp) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.1 false 6.1.1.1 Adenosine triphosphate + Hydrogen Ion + L-Tyrosine + tRNA(Tyr) → Adenosine monophosphate + L-tyrosyl-tRNA(Tyr) + Pyrophosphate LEFT_TO_RIGHT L-Lysyl-tRNA P0A8L1 UniProt 6.1.1.5 false 6.1.1.5 Adenosine triphosphate + Hydrogen Ion + L-Isoleucine + tRNA(Ile) → Adenosine monophosphate + L-Isoleucyl-tRNA(Ile) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.18 false 6.1.1.18 Adenosine triphosphate + Hydrogen Ion + L-Glutamine + tRNA(Gln) → Adenosine diphosphate + L-Glutaminyl-tRNA(Gln) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.4 false 6.1.1.4 Adenosine triphosphate + Hydrogen Ion + L-Leucine + tRNA(Leu) → Adenosine monophosphate + L-Leucyl-tRNA(Leu) + Pyrophosphate LEFT_TO_RIGHT Asparaginyl-tRNA synthetase 147-85-3 CAS 6.1.1.9 false 6.1.1.9 Adenosine triphosphate + Hydrogen Ion + L-Valine + tRNA(Val) → Adenosine monophosphate + L-Valyl-tRNA(Val) + Pyrophosphate LEFT_TO_RIGHT Seryl-tRNA synthetase 1.0 1.0 1.0 CHEBI:16414 ChEBI 6306 PubChem-compound 6305 PubChem-compound Glutamyl-tRNA synthetase 1.0 14000-31-8 CAS 2.0 P07395 UniProt ILE BioCyc 1.0 SMILES N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O CHEBI:15422 ChEBI CHEBI:16635 ChEBI HMDB00191 HMDB SMILES CC(C)[C@H](N)C(O)=O Threonine/serine transporter tdcC 28782 PubChem-compound 2.0 HIS BioCyc P60906 UniProt C5H9NO4 L-Glutamic acid 147.05316 33032 PubChem-compound CHEBI:17732 ChEBI PW000794 PathWhiz 60-18-4 CAS CHEBI:16643 ChEBI 1.0 PW000790 PathWhiz CHEBI:16761 ChEBI 1.0 1.0 CHEBI:15428 ChEBI PW000789 PathWhiz PW000788 PathWhiz HMDB00177 HMDB P08312 UniProt 61-90-5 CAS Valyl-tRNA synthetase Aspartyl-tRNA synthetase Cysteinyl-tRNA synthetase HMDB00172 HMDB Phenylalanyl-tRNA synthetase beta chain P00956 UniProt P00957 UniProt P00959 UniProt P00954 UniProt CHEBI:16467 ChEBI CHEBI:15378 ChEBI SMILES [H+] P07118 UniProt C00407 KEGG Compound Leucyl-tRNA synthetase SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 56-45-1 CAS HMDB00182 HMDB HMDB00187 HMDB VAL BioCyc P21888 UniProt SMILES CC(C)C[C@H](N)C(O)=O P00960 UniProt P00961 UniProt 1.0 P00962 UniProt P21889 UniProt L-alanyl-tRNA(Ala) tRNA(Ala) HMDB00158 HMDB HMDB00159 HMDB L-asparaginyl-tRNA(Asn) tRNA(Asn) L-aspartyl-tRNA(Asp) tRNA(Asp) L-cysteinyl-tRNA(Cys) tRNA(Cys) Histidyl-tRNA synthetase SMILES N[C@@H](CCC(N)=O)C(O)=O L-methionyl-tRNA(Met) tRNA(Phe) Phenylalanyl-tRNA synthetase alpha chain tRNA(Pro) L-prolyl-tRNA(Pro) tRNA(Arg) L-arginyl-tRNA(Arg) tRNA(Glu) L-glutamyl-tRNA(Glu) tRNA(Met) HMDB00045 HMDB HMDB00167 HMDB CHEBI:17895 ChEBI HMDB00168 HMDB P11875 UniProt 74-79-3 CAS Arginyl-tRNA synthetase 1.0 HMDB00161 HMDB HMDB00162 HMDB 1.0 2.0 1.0 1.0 Arginyl-tRNA synthetase Cysteinyl-tRNA synthetase Glutamyl-tRNA synthetase Alanyl-tRNA synthetase Glycyl-tRNA synthetase beta subunit Glycyl-tRNA synthetase alpha subunit Seryl-tRNA synthetase Threonine/serine transporter tdcC Leucyl-tRNA synthetase Valyl-tRNA synthetase Isoleucyl-tRNA synthetase Glutaminyl-tRNA synthetase Aspartyl-tRNA synthetase Tyrosyl-tRNA synthetase Tryptophanyl- tRNA synthetase Phenylalanyl- tRNA synthetase alpha chain Phenylalanyl- tRNA synthetase beta chain Asparaginyl- tRNA synthetase Histidyl-tRNA synthetase Lysyl-tRNA synthetase, heat inducible Methionyl-tRNA synthetase Prolyl-tRNA synthetase L-Arginine ATP H + PP i AMP L-Cysteine ATP H + PP i AMP L-Glutamic acid ATP H + PP i AMP L-Alanine ATP H + PP i AMP Glycine ATP H + AMP PP i L-Serine ATP H + AMP PP i L-Threonine ATP H + PP i AMP L-Leucine ATP H + AMP PP i L-Valine ATP H + AMP PP i L-Isoleucine ATP H + AMP PP i L-Glutamine ATP H + ADP PP i L-Aspartic acid ATP H + PP i AMP L-Tyrosine ATP H + AMP PP i L-Tryptophan ATP H + AMP PP i L-Phenylalanine ATP H + AMP PP i L-Asparagine ATP H + PP i AMP L-Histidine ATP H + AMP PP i L-Lysine ATP H + AMP PP i L-Methionine ATP H + AMP PP i L-Proline ATP H + AMP PP i tRNA(Arg) L-arginyl- tRNA(Arg) tRNA(Cys) L-cysteinyl- tRNA(Cys) tRNA(Glu) L-glutamyl- tRNA(Glu) tRNA(Ala) L-alanyl- tRNA(Ala) tRNA(gly) Glycyl- tRNA(Gly) tRNA(Ser) L-Seryl- tRNA(Ser) tRNA(Thr) L-Threonyl- tRNA(Thr) tRNA(Leu) L-Leucyl- tRNA(Leu) tRNA(Val) L-Valyl- tRNA(Val) tRNA(Ile) L-Isoleucyl- tRNA(Ile) tRNA(Gln) L-Glutaminyl- tRNA(Gln) tRNA(Asp) L-aspartyl- tRNA(Asp) tRNA(Tyr) L-tyrosyl- tRNA(Tyr) tRNA(Trp) L-tryptophyl- tRNA(Trp) tRNA(Phe) L- phenylalanyl- tRNA(Phe) tRNA(Asn) L- asparaginyl- tRNA(Asn) tRNA(His) L-histidyl- tRNA(His) tRNA(Lys) L-Lysyl-tRNA tRNA(Met) L-methionyl- tRNA(Met) tRNA(Pro) L-prolyl- tRNA(Pro) arginine metabolism cysteine biosynthesis L-glutamate metabolism L-alanine metabolism Lysine Biosynthesis proline metabolism Aspartate metabolism tyrosine biosynthesis GLYCINE BIOSYNTHESIS Asparagine biosynthesis Valine Biosynthesis histidine biosynthesis Leucine Biosynthesis phenylalanine biosynthesis L-glutamate metabolism serine biosynthesis and metabolism tryptophan metabolism methionine biosynthesis threonine biosynthesis isoleucine biosynthesis
CHEBI:16015 ChEBI C5H11NO2 L-Valine 117.07898 6022 PubChem-compound 6140 PubChem-compound 1.0 CYS BioCyc 1.0 HMDB00250 HMDB 6267 PubChem-compound HMDB01341 HMDB 63-91-2 CAS 946416 INSDC 1.0 73-32-5 CAS 1.0 CHEBI:16027 ChEBI CHEBI:17115 ChEBI HMDB00148 HMDB 945331 INSDC 5833 ChemSpider Glycyl-tRNA synthetase alpha subunit Glycyl-tRNA synthetase beta subunit Alanyl-tRNA synthetase ATP BioCyc Methionyl-tRNA synthetase 6137 PubChem-compound Glutaminyl-tRNA synthetase 1.0 Tryptophanyl-tRNA synthetase Isoleucyl-tRNA synthetase 559142 ChemSpider PRO BioCyc 1.0 945336 INSDC 6287 PubChem-compound 6288 PubChem-compound 5747 ChemSpider CHEBI:17203 ChEBI 5746 ChemSpider 1.0 5745 ChemSpider 5742 ChemSpider ASN BioCyc L-ASPARTATE BioCyc 1.0 CHEBI:17561 ChEBI HMDB59597 HMDB TYR BioCyc ARG BioCyc 5858 ChemSpider 1.0 HMDB00123 HMDB 5736 ChemSpider 6274 PubChem-compound L-Valine 1.0 5735 ChemSpider 1.0 1.0 1.0 Prolyl-tRNA synthetase 1010 ChemSpider 73-22-3 CAS Glutamyl-tRNA synthetase PPI BioCyc 1.0 1.0 HMDB00574 HMDB HMDB00696 HMDB Hydrogen Ion C5H10N2O3 L-Glutamine 146.06914 1.0 C11H12N2O2 L-Tryptophan 204.08987 6106 PubChem-compound Adenosine triphosphate 5880 ChemSpider 1.0 1.0 56-87-1 CAS C00008 KEGG Compound 1.0 1.0 L-ALPHA-ALANINE BioCyc LEU BioCyc CHEBI:18361 ChEBI 56-41-7 CAS CHEBI:18366 ChEBI C00002 KEGG Compound C00123 KEGG Compound 945257 INSDC 1.0 1.0 945264 INSDC 44367445 PubChem-compound C00135 KEGG Compound C00013 KEGG Compound Threonine/serine transporter tdcC 1.0 1.0 947202 INSDC H Hydrogen Ion 1.007825 HMDB00687 HMDB L-Glutamine 56-65-5 CAS L-Tryptophan MET BioCyc C00020 KEGG Compound 5653 ChemSpider C00148 KEGG Compound 2.0 C00025 KEGG Compound Cysteinyl-tRNA synthetase Aspartyl-tRNA synthetase 1.0 C5H11NO2S L-Methionine 149.05106 CHEBI:29170 ChEBI CHEBI:29172 ChEBI CHEBI:29171 ChEBI SubPathwayInteraction1169 SubPathway1169Reaction SubPathwayReaction 52-90-4 CAS P16659 UniProt C00152 KEGG Compound SubPathwayInteraction1165 SubPathway1165Reaction SubPathwayReaction C00037 KEGG Compound SubPathwayInteraction1164 SubPathwayReaction SubPathway1164Reaction SubPathwayInteraction1166 SubPathway1166Reaction SubPathwayReaction SubPathwayInteraction1172 SubPathway1172Reaction SubPathwayReaction SubPathwayInteraction1171 SubPathway1171Reaction SubPathwayReaction AMP BioCyc Tyrosyl-tRNA synthetase C00041 KEGG Compound 1.0 L-prolyl-tRNA(Pro) SubPathwayInteraction1170 SubPathwayReaction SubPathway1170Reaction L-arginyl-tRNA(Arg) CHEBI:29173 ChEBI tRNA(Pro) tRNA(Cys) tRNA(Arg) CHEBI:29175 ChEBI CHEBI:29178 ChEBI L-methionyl-tRNA(Met) L-cysteinyl-tRNA(Cys) CHEBI:29177 ChEBI SMILES [O-]P([O-])(=O)OP([O-])([O-])=O tRNA(Phe) CHEBI:29161 ChEBI CHEBI:17196 ChEBI 128566 ChemSpider C00049 KEGG Compound L-Cysteine C00047 KEGG Compound 56-85-9 CAS SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 1.0 L-phenylalanyl-tRNA(Phe) Histidyl-tRNA synthetase L-tyrosyl-tRNA(Tyr) CHEBI:17191 ChEBI tRNA(Tyr) L-histidyl-tRNA(His) HMDB00538 HMDB CHEBI:29162 ChEBI 944884 INSDC tRNA(His) http://identifiers.org/smpdb/SMP00794 SMPDB L-Seryl-tRNA(Ser) L-tryptophyl-tRNA(Trp) CHEBI:29167 ChEBI TRP BioCyc Glycyl-tRNA(Gly) 1.0 CHEBI:18019 ChEBI Arginyl-tRNA synthetase SMILES N[C@@H](CCCNC(N)=N)C(O)=O 61-19-8 CAS 72-18-4 CAS SMILES NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 CHEBI:29159 ChEBI 1.0 C00062 KEGG Compound C00183 KEGG Compound 56-86-0 CAS CHEBI:29152 ChEBI 63-68-3 CAS CHEBI:29154 ChEBI CHEBI:29153 ChEBI CHEBI:29156 ChEBI CHEBI:29155 ChEBI CHEBI:29158 ChEBI CHEBI:29157 ChEBI 945501 INSDC 5907 ChemSpider HMDB00883 HMDB HMDB00641 HMDB C10H16N5O13P3 Adenosine triphosphate 506.99576 1.0 C00188 KEGG Compound CHEBI:17053 ChEBI CHEBI:17295 ChEBI 56-40-6 CAS C00065 KEGG Compound C00064 KEGG Compound L-Methionine Asparaginyl-tRNA synthetase Seryl-tRNA synthetase L-Leucine C00073 KEGG Compound HMDB00517 HMDB C6H13NO2 L-Leucine 131.09464 PHE BioCyc CHEBI:29265 ChEBI C4H9NO3 L-Threonine 119.05824 C5H9NO2 L-Proline 115.06333 C3H7NO2 L-Alanine 89.047676 C9H11NO2 L-Phenylalanine 165.07898 5800 ChemSpider C9H11NO3 L-Tyrosine 181.0739 C00078 KEGG Compound 145742 PubChem-compound C00079 KEGG Compound Lysyl-tRNA synthetase, heat inducible C00080 KEGG Compound 730 ChemSpider PW000818 PathWhiz 1.0 1.0 arginine metabolism SubPathway C00082 KEGG Compound PW000813 PathWhiz C6H13NO2 L-Isoleucine 131.09464 PW000812 PathWhiz proline metabolism SubPathway PW000811 PathWhiz C4H8N2O3 L-Asparagine 132.0535 PW000810 PathWhiz SMILES N[C@@H](CCC(O)=O)C(O)=O PW000817 PathWhiz tRNA Charging 2 PW000815 PathWhiz PW000814 PathWhiz 6057 PubChem-compound C6H14N2O2 L-Lysine 146.10553 C6H9N3O2 L-Histidine 155.06947 5910 ChemSpider 58-64-0 CAS 1.0 PW000809 PathWhiz PW000808 PathWhiz PW000807 PathWhiz L-Aspartic acid L-Serine C4H7NO4 L-Aspartic acid 133.0375 PW000800 PathWhiz C3H7NO3 L-Serine 105.042595 PW000806 PathWhiz 1.0 PW000803 PathWhiz 644102 PubChem-compound C3H7NO2S L-Cysteine 121.01975 2.0 6083 PubChem-compound L-Histidine C00097 KEGG Compound B1XGT1 UniProt L-Lysine SubPathwayInteraction1152 SubPathwayReaction SubPathway1152Reaction SubPathwayInteraction1151 SubPathway1151Reaction SubPathwayReaction L-Isoleucine CHEBI:18050 ChEBI L-Asparagine Prolyl-tRNA synthetase SMILES NCC(O)=O CHEBI:29182 ChEBI L-Alanine SubPathwayInteraction1158 SubPathway1158Reaction SubPathwayReaction 56-84-8 CAS L-Phenylalanine SubPathwayInteraction1157 SubPathway1157Reaction SubPathwayReaction L-Tyrosine 1.0 SubPathwayInteraction1159 SubPathwayReaction SubPathway1159Reaction L-Threonine SubPathwayInteraction1154 SubPathway1154Reaction SubPathwayReaction 1.0 SubPathwayInteraction1156 SubPathwayReaction SubPathway1156Reaction L-Proline SubPathwayInteraction1155 SubPathwayReaction SubPathway1155Reaction SubPathwayInteraction1161 SubPathwayReaction SubPathway1161Reaction SubPathwayInteraction1160 SubPathway1160Reaction SubPathwayReaction ReactionCatalysis2800 ACTIVATION SubPathwayInteraction1163 SubPathwayReaction SubPathway1163Reaction SubPathwayInteraction1162 SubPathwayReaction SubPathway1162Reaction ReactionCatalysis2802 ACTIVATION 70-47-3 CAS ReactionCatalysis2801 ACTIVATION ReactionCatalysis2803 ACTIVATION CHEBI:29184 ChEBI 1.0 1.0 2.0 CHEBI:29186 ChEBI 1.0 P07813 UniProt 2.0 http://identifiers.org/smpdb/SMP00824 SMPDB 1.0 30572 ChemSpider http://identifiers.org/smpdb/SMP00826 SMPDB CHEBI:15603 ChEBI http://identifiers.org/smpdb/SMP00821 SMPDB 948275 INSDC SMILES N[C@@H](CS)C(O)=O L-Valyl-tRNA(Val) tRNA(Val) tRNA(Ile) http://identifiers.org/smpdb/SMP00827 SMPDB 2.0 http://identifiers.org/smpdb/SMP00828 SMPDB http://identifiers.org/smpdb/SMP00829 SMPDB tRNA(Ser) tRNA(gly) P0AGJ9 UniProt L-Threonyl-tRNA(Thr) tRNA(Thr) L-Leucyl-tRNA(Leu) tRNA(Leu) P0A8M0 UniProt 1.0 C6H14N4O2 L-Arginine 174.11168 Pyrophosphate C10H14N5O7P Adenosine monophosphate 347.06308 HMDB00929 HMDB CHEBI:15971 ChEBI http://identifiers.org/smpdb/SMP00834 SMPDB http://identifiers.org/smpdb/SMP00835 SMPDB Phenylalanyl-tRNA synthetase beta chain http://identifiers.org/smpdb/SMP00837 SMPDB http://identifiers.org/smpdb/SMP00830 SMPDB http://identifiers.org/smpdb/SMP00831 SMPDB http://identifiers.org/smpdb/SMP00832 SMPDB Valyl-tRNA synthetase http://identifiers.org/smpdb/SMP00833 SMPDB L-Seryl-tRNA(Ser) Glycyl-tRNA(Gly) 5961 PubChem-compound http://identifiers.org/smpdb/SMP00838 SMPDB 5962 PubChem-compound 1.0 ReactionCatalysis2787 ACTIVATION ReactionCatalysis2786 ACTIVATION 1.0 ReactionCatalysis2789 ACTIVATION tRNA(Tyr) ReactionCatalysis2788 ACTIVATION L-phenylalanyl-tRNA(Phe) SMILES N[C@@H](CC1=CC=C(O)C=C1)C(O)=O tRNA(His) L-tyrosyl-tRNA(Tyr) L-tryptophyl-tRNA(Trp) L-histidyl-tRNA(His) ADP BioCyc P0A8N5 UniProt ReactionCatalysis2785 ACTIVATION ReactionCatalysis2784 ACTIVATION tRNA(Asn) L-alanyl-tRNA(Ala) tRNA(Ala) 1.0 Leucyl-tRNA synthetase THR BioCyc 6038 ChemSpider tRNA(Met) 1038 PubChem-compound tRNA(Glu) L-glutamyl-tRNA(Glu) L-aspartyl-tRNA(Asp) tRNA(Asp) L-asparaginyl-tRNA(Asn) SMILES CSCC[C@H](N)C(O)=O ReactionCatalysis2798 ACTIVATION LYS BioCyc ReactionCatalysis2797 ACTIVATION ReactionCatalysis2799 ACTIVATION L-Arginine Adenosine monophosphate ReactionCatalysis2790 ACTIVATION Lysine Biosynthesis SubPathway ReactionCatalysis2792 ACTIVATION ReactionCatalysis2791 ACTIVATION ReactionCatalysis2794 ACTIVATION ReactionCatalysis2793 ACTIVATION ReactionCatalysis2796 ACTIVATION ReactionCatalysis2795 ACTIVATION L-glutamate metabolism ActivatingSubPathway Phenylalanyl-tRNA synthetase alpha chain 1.0 2.0 5862 PubChem-compound SER BioCyc tRNA(Gln) L-Isoleucyl-tRNA(Ile) 6031 ChemSpider tRNA(Trp) L-Glutaminyl-tRNA(Gln) L-Lysyl-tRNA tRNA(Lys) Aspartate metabolism SubPathway L-alanine metabolism SubPathway GLY BioCyc Reaction2829 false Adenosine triphosphate + Hydrogen Ion + L-Threonine + tRNA(Thr) → Adenosine monophosphate + L-Threonyl-tRNA(Thr) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.14 false 6.1.1.14 Adenosine triphosphate + Glycine + Hydrogen Ion + tRNA(gly) → Adenosine monophosphate + Glycyl-tRNA(Gly) + Pyrophosphate LEFT_TO_RIGHT PW000787 PathWhiz 6.1.1.11 false 6.1.1.11 Adenosine triphosphate + Hydrogen Ion + L-Serine + tRNA(Ser) → Adenosine monophosphate + L-Seryl-tRNA(Ser) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.17 false 6.1.1.17 Adenosine triphosphate + Hydrogen Ion + L-Glutamic acid + tRNA(Glu) → Adenosine monophosphate + L-glutamyl-tRNA(Glu) + Pyrophosphate LEFT_TO_RIGHT CHEBI:16857 ChEBI 6.1.1.7 false 6.1.1.7 Adenosine triphosphate + Hydrogen Ion + L-Alanine + tRNA(Ala) → Adenosine monophosphate + L-alanyl-tRNA(Ala) + Pyrophosphate LEFT_TO_RIGHT CHEBI:16977 ChEBI glycyl-tRNA synthetase 71-00-1 CAS 1.0 SubPathwayControl1153 ActivatingSubPathwayControl SubPathway1153Control 1.0 L-Glutamic acid 72-19-5 CAS 6.1.1.19 false 6.1.1.19 Adenosine triphosphate + Hydrogen Ion + L-Arginine + tRNA(Arg) → Adenosine monophosphate + L-arginyl-tRNA(Arg) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.16 false 6.1.1.16 Adenosine triphosphate + Hydrogen Ion + L-Cysteine + tRNA(Cys) → Adenosine monophosphate + L-cysteinyl-tRNA(Cys) + Pyrophosphate LEFT_TO_RIGHT C2H5NO2 Glycine 75.03203 alanyl-tRNA synthetase Tyrosyl-tRNA synthetase PW000771 PathWhiz 1.0 1.0 6050 ChemSpider 5257127 PubChem-compound 6051 ChemSpider seryl-tRNA synthetase GLN BioCyc GLT BioCyc P04805 UniProt 1.0 1.0 Glycyl-tRNA synthetase beta subunit Glutaminyl-tRNA synthetase Methionyl-tRNA synthetase Glycyl-tRNA synthetase alpha subunit Isoleucyl-tRNA synthetase histidyl-tRNA synthetase http://identifiers.org/smpdb/SMP00809 SMPDB Alanyl-tRNA synthetase SMILES OC(=O)[C@@H]1CCCN1 SMILES C[C@H](N)C(O)=O methionyl-tRNA synthetase 2.0 Tryptophanyl-tRNA synthetase SMILES N[C@@H](CC1=CC=CC=C1)C(O)=O lysine tRNA synthetase 5950 PubChem-compound 5951 PubChem-compound SMILES C[C@@H](O)[C@H](N)C(O)=O SMILES N[C@@H](CC(N)=O)C(O)=O O7P2 Pyrophosphate 173.91193 tRNA(gly) 6082 ChemSpider Glycine tRNA(Thr) SMILES CC[C@H](C)[C@H](N)C(O)=O 5957 PubChem-compound tRNA(Ser) phenylalanyl-tRNA synthetase tRNA(Leu) L-Threonyl-tRNA(Thr) tRNA(Val) CHEBI:16828 ChEBI L-Leucyl-tRNA(Leu) tRNA(Ile) 6.1.1.10 false 6.1.1.10 Adenosine triphosphate + Hydrogen Ion + L-Methionine + tRNA(Met) → Adenosine monophosphate + L-methionyl-tRNA(Met) + Pyrophosphate LEFT_TO_RIGHT L-Valyl-tRNA(Val) 6.1.1.15 false 6.1.1.15 Adenosine triphosphate + Hydrogen Ion + L-Proline + tRNA(Pro) → Adenosine monophosphate + L-prolyl-tRNA(Pro) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.6 false 6.1.1.6 Adenosine triphosphate + Hydrogen Ion + L-Lysine + tRNA(Lys) → Adenosine monophosphate + L-Lysyl-tRNA + Pyrophosphate LEFT_TO_RIGHT http://identifiers.org/smpdb/SMP00812 SMPDB http://identifiers.org/smpdb/SMP00815 SMPDB 6.1.1.22 false 6.1.1.22 Adenosine triphosphate + Hydrogen Ion + L-Asparagine + tRNA(Asn) → Adenosine monophosphate + L-asparaginyl-tRNA(Asn) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.21 false 6.1.1.21 Adenosine triphosphate + Hydrogen Ion + L-Histidine + tRNA(His) → Adenosine monophosphate + L-histidyl-tRNA(His) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.2 false 6.1.1.2 Adenosine triphosphate + Hydrogen Ion + L-Tryptophan + tRNA(Trp) → Adenosine monophosphate + L-tryptophyl-tRNA(Trp) + Pyrophosphate LEFT_TO_RIGHT http://identifiers.org/smpdb/SMP00810 SMPDB 6.1.1.20 false 6.1.1.20 Adenosine triphosphate + Hydrogen Ion + L-Phenylalanine + tRNA(Phe) → Adenosine monophosphate + L-phenylalanyl-tRNA(Phe) + Pyrophosphate LEFT_TO_RIGHT http://identifiers.org/smpdb/SMP00811 SMPDB SMILES NCCCC[C@H](N)C(O)=O SMILES N[C@@H](CC1=CN=CN1)C(O)=O 6067 ChemSpider 6066 ChemSpider SMILES N[C@@H](CO)C(O)=O Adenosine diphosphate L-Isoleucyl-tRNA(Ile) Lysyl-tRNA synthetase, heat inducible C10H15N5O10P2 Adenosine diphosphate 427.02942 L-Glutaminyl-tRNA(Gln) tRNA(Gln) prolyl-tRNA synthetase SMILES N[C@@H](CC(O)=O)C(O)=O tRNA(Lys) 1.0 tRNA(Trp) 6.1.1.12 false 6.1.1.12 Adenosine triphosphate + Hydrogen Ion + L-Aspartic acid + tRNA(Asp) → Adenosine monophosphate + L-aspartyl-tRNA(Asp) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.1 false 6.1.1.1 Adenosine triphosphate + Hydrogen Ion + L-Tyrosine + tRNA(Tyr) → Adenosine monophosphate + L-tyrosyl-tRNA(Tyr) + Pyrophosphate LEFT_TO_RIGHT L-Lysyl-tRNA P0A8L1 UniProt 6.1.1.5 false 6.1.1.5 Adenosine triphosphate + Hydrogen Ion + L-Isoleucine + tRNA(Ile) → Adenosine monophosphate + L-Isoleucyl-tRNA(Ile) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.18 false 6.1.1.18 Adenosine triphosphate + Hydrogen Ion + L-Glutamine + tRNA(Gln) → Adenosine diphosphate + L-Glutaminyl-tRNA(Gln) + Pyrophosphate LEFT_TO_RIGHT 6.1.1.4 false 6.1.1.4 Adenosine triphosphate + Hydrogen Ion + L-Leucine + tRNA(Leu) → Adenosine monophosphate + L-Leucyl-tRNA(Leu) + Pyrophosphate LEFT_TO_RIGHT Asparaginyl-tRNA synthetase 147-85-3 CAS 6.1.1.9 false 6.1.1.9 Adenosine triphosphate + Hydrogen Ion + L-Valine + tRNA(Val) → Adenosine monophosphate + L-Valyl-tRNA(Val) + Pyrophosphate LEFT_TO_RIGHT Seryl-tRNA synthetase 1.0 1.0 1.0 CHEBI:16414 ChEBI 6306 PubChem-compound 6305 PubChem-compound Glutamyl-tRNA synthetase 1.0 14000-31-8 CAS cysteine biosynthesis SubPathway 2.0 tyrosine biosynthesis SubPathway phenylalanine biosynthesis SubPathway GLYCINE BIOSYNTHESIS SubPathway serine biosynthesis and metabolism SubPathway P07395 UniProt ILE BioCyc 1.0 SMILES N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O Leucine Biosynthesis SubPathway Valine Biosynthesis SubPathway Asparagine biosynthesis SubPathway CHEBI:15422 ChEBI methionine biosynthesis SubPathway CHEBI:16635 ChEBI tryptophan metabolism SubPathway threonine biosynthesis SubPathway isoleucine biosynthesis SubPathway HMDB00191 HMDB SMILES CC(C)[C@H](N)C(O)=O Threonine/serine transporter tdcC 28782 PubChem-compound 2.0 HIS BioCyc P60906 UniProt C5H9NO4 L-Glutamic acid 147.05316 histidine biosynthesis SubPathway 33032 PubChem-compound CHEBI:17732 ChEBI PW000794 PathWhiz 60-18-4 CAS CHEBI:16643 ChEBI 1.0 PW000790 PathWhiz CHEBI:16761 ChEBI 1.0 1.0 CHEBI:15428 ChEBI PW000789 PathWhiz PW000788 PathWhiz HMDB00177 HMDB P08312 UniProt 61-90-5 CAS Valyl-tRNA synthetase Aspartyl-tRNA synthetase Cysteinyl-tRNA synthetase HMDB00172 HMDB Phenylalanyl-tRNA synthetase beta chain P00956 UniProt P00957 UniProt P00959 UniProt P00954 UniProt CHEBI:16467 ChEBI CHEBI:15378 ChEBI SMILES [H+] P07118 UniProt C00407 KEGG Compound Leucyl-tRNA synthetase SMILES NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O 56-45-1 CAS HMDB00182 HMDB HMDB00187 HMDB VAL BioCyc P21888 UniProt SMILES CC(C)C[C@H](N)C(O)=O P00960 UniProt P00961 UniProt 1.0 P00962 UniProt P21889 UniProt L-alanyl-tRNA(Ala) tRNA(Ala) HMDB00158 HMDB HMDB00159 HMDB L-asparaginyl-tRNA(Asn) tRNA(Asn) L-aspartyl-tRNA(Asp) tRNA(Asp) L-cysteinyl-tRNA(Cys) tRNA(Cys) Histidyl-tRNA synthetase SMILES N[C@@H](CCC(N)=O)C(O)=O L-methionyl-tRNA(Met) tRNA(Phe) Phenylalanyl-tRNA synthetase alpha chain tRNA(Pro) L-prolyl-tRNA(Pro) tRNA(Arg) L-arginyl-tRNA(Arg) tRNA(Glu) L-glutamyl-tRNA(Glu) tRNA(Met) HMDB00045 HMDB HMDB00167 HMDB CHEBI:17895 ChEBI HMDB00168 HMDB P11875 UniProt 74-79-3 CAS Arginyl-tRNA synthetase 1.0 HMDB00161 HMDB HMDB00162 HMDB 1.0 2.0 1.0 1.0